
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 10420-75-4 |
| Catalog No. | 2A-9063303 |
| Chinese Name | 4H-1-BENZOPYRAN-4-ONE, 2-(4-CHLOROPHENYL) |
| Synonyms | 4'-Chloroflavone |
| Molecular Formula | C15H8ClFO2 |
| Molecular Weight | 256.68400 |
| Density | 1.342g/cm3 |
| Boiling Point | 391ºC at 760mmHg |
| Appearance | solid |
| HTC | 2914700090 |
| MDL Number | MFCD03070566 |
| SMILES | ClC1=CC=C(C2=CC(C3=C(O2)C=CC(F)=C3)=O)C=C1 |
| InChI | 1S/C15H8ClFO2/c16-10-3-1-9(2-4-10)15-8-13(18)12-7-11(17)5-6-14(12)19-15/h1-8H |
| InChI Key | KORJBHAWGHTRHT-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352101 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzoic acid, 2-[(1E)-2-carboxyethenyl]- | 18454-53-0 | 2A-9063296 |
| Benzenepropanoic acid, 2-carboxy- | 776-79-4 | 2A-9063297 |
| 4H-1-Benzopyran-4-one, 2-ethyl- | 14736-30-2 | 2A-9063299 |
| 4H-1-Benzopyran-4-one, 2-methyl- | 5751-48-4 | 2A-9063300 |
| 4H-1-Benzopyran-4-one, 2-(4-methylphenyl)- | 41255-30-5 | 2A-9063301 |
| 4H-1-Benzopyran-4-one, 2-(4-bromophenyl)- | 20525-20-6 | 2A-9063304 |
| 4H-1-Benzopyran-4-one, 2-(4-fluorophenyl)- | 1645-21-2 | 2A-9063306 |
| 4H-1-Benzopyran-4-one, 2-(4-methoxyphenyl)- | 4143-74-2 | 2A-9063307 |
| 4H-1-Benzopyran-4-one, 2-(4-nitrophenyl)- | 19725-49-6 | 2A-9063309 |
| 9(10H)-Acridinone, 2-methyl- | 23864-43-9 | 2A-9063311 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA