
CAS Number445-01-2
SynonymsGR DE BXFFF; 5-Bromo-2-chloro-α,α,α-trifluorotoluene; MFCD00000601; EINECS 207-149-2; 4-Bromo-1-chloro-2-(trifluoromethyl)benzene; 5-Bromo-2-chlorobenzotrifluoride
Molecular FormulaC7H3BrClF3
Molecular Weight307.10
Purity≥99 (HPLC)%
Density1.7±0.1 g/cm3
Boiling Point198.8±35.0 °C at 760 mmHg
Melting Point191-194 °C (dec.) (lit.)
Appearancepowder
EINECS200-415-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 445-01-2 |
| Catalog No. | 2A-9006322 |
| Chinese Name | 5-溴-2-氯三氟甲苯 |
| Synonyms | GR DE BXFFF; 5-Bromo-2-chloro-α,α,α-trifluorotoluene; MFCD00000601; EINECS 207-149-2; 4-Bromo-1-chloro-2-(trifluoromethyl)benzene; 5-Bromo-2-chlorobenzotrifluoride |
| Molecular Formula | C7H3BrClF3 |
| Molecular Weight | 307.10 |
| Purity | ≥99 (HPLC) |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 198.8±35.0 °C at 760 mmHg |
| Melting Point | 191-194 °C (dec.) (lit.) |
| Appearance | powder |
| Storage Condition | Seal container tightly and keep refrigerated. |
| EINECS | 200-415-9 |
| HTC | 2903999090 |
| PubChem ID | 24278270 |
| MDL Number | MFCD00006529 |
| SMILES | OC[C@H]1O[C@H](C[C@@H]1O)N2C=C(Br)C(=O)NC2=O |
| InChI | 1S/C9H11BrN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5-,6+,7+/m0/s1 |
| InChI Key | WOVKYSAHUYNSMH-RRKCRQDMSA-N |
| Beilstein/REAXYS | 30395 |
| NACRES Code | NA.51 |
| UNSPSC | 41106305 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S27;S28;S36/37/39 |
| MSDS | msds/6322_1_445_01_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Bromo-2,3-difluoroanisole | 261762-35-0 | 2A-9006310 |
| 5-Bromo-2,3-difluorophenol | 186590-26-1 | 2A-9006311 |
| 5-Bromo-2-chloro-1,3-difluorobenzene | 176673-72-6 | 2A-9006318 |
| 5-Bromo-2-chloroaniline | 60811-17-8 | 2A-9006320 |
| 5-Bromo-2-chloroanisole | 16817-43-9 | 2A-9006321 |
| 5-Bromo-2-chlorobenzoyl chloride | 21900-52-7 | 2A-9006323 |
| 5-Bromo-2-fluoroaniline | 2924-09-6 | 2A-9006332 |
| 5-Bromo-2-fluorobenzoic acid | 146328-85-0 | 2A-9006334 |
| 5-Bromo-2-fluorobenzonitrile | 179897-89-3 | 2A-9006335 |
| 5-Bromo-2-fluorobenzotrifluoride | 393-37-3 | 2A-9006336 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA