
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68262-20-4 |
| Catalog No. | 2A-9063215 |
| Chinese Name | 3-(3-methoxyphenyl)-2-oxo-propanoic acid |
| Synonyms | <3-Methoxy-phenyl>-brenztraubensaeure; 3-methoxyphenylpyruvic acid |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.18400 |
| Density | 1.256g/cm3 |
| Boiling Point | 342.4ºC at 760 mmHg |
| HTC | 2918990090 |
| SMILES | COc1cccc(CC(=O)C(=O)O)c1 |
| InChI | InChI=1S/C10H10O4/c1-14-8-4-2-3-7(5-8)6-9(11)10(12)13/h2-5H,6H2,1H3,(H,12,13) |
| InChI Key | QRICSZPYENRNSS-UHFFFAOYSA-N |
| MSDS | msds/63215_1_68262_20_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenepropanoic acid, 3-methyl-.alpha.-oxo- | 61676-25-3 | 2A-9063210 |
| Benzenepropanoic acid, 3-fluoro-.alpha.-oxo- | 95041-89-7 | 2A-9063211 |
| Benzenepropanoic acid, 3-chloro-.alpha.-oxo- | 96406-06-3 | 2A-9063212 |
| Benzenepropanoic acid, 3-bromo-.alpha.-oxo- | 207910-90-5 | 2A-9063213 |
| Benzenepropanoic acid, 3-hydroxy-.alpha.-oxo- | 4607-41-4 | 2A-9063214 |
| Benzenepropanoic acid, 3-ethoxy-.alpha.-oxo- | 858276-63-8 | 2A-9063216 |
| Benzenepropanoic acid, .alpha.-oxo-3-(phenylmethoxy)- | 856196-99-1 | 2A-9063217 |
| Benzenepropanoic acid, .alpha.-oxo-3-phenoxy- | 954584-15-7 | 2A-9063218 |
| Benzenepropanoic acid, .alpha.-oxo-2-(trifluoromethoxy)- | 954583-86-9 | 2A-9063221 |
| Benzenepropanoic acid, 2-ethoxy-.alpha.-oxo- | 857763-64-5 | 2A-9063222 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA