
CAS Number38335-24-9
Synonyms3-(4-NITROPHENYL)-2-OXO-PROPANOIC ACID; (4-nitrophenyl)pyruvic acid; (4-Nitro-phenyl)-brenztraubensaeure; p-Nitrophenylpyruvic acid; 3-(4-nitro-phenyl)-2-oxo-propionic acid
Molecular FormulaC9H7NO5
Molecular Weight209.15600
Density1.469g/cm3
Boiling Point410ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 38335-24-9 |
| Catalog No. | 2A-9063207 |
| Chinese Name | (对硝基苯基)丙酮酸 |
| Synonyms | 3-(4-NITROPHENYL)-2-OXO-PROPANOIC ACID; (4-nitrophenyl)pyruvic acid; (4-Nitro-phenyl)-brenztraubensaeure; p-Nitrophenylpyruvic acid; 3-(4-nitro-phenyl)-2-oxo-propionic acid |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.15600 |
| Density | 1.469g/cm3 |
| Boiling Point | 410ºC at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2918300090 |
| SMILES | O=C(O)C(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H7NO5/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4H,5H2,(H,12,13) |
| InChI Key | CIGYFQSAFKLMAL-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| [1,1'-Biphenyl]-4-propanoic acid, .alpha.-oxo- | 91853-46-2 | 2A-9063202 |
| Benzenepropanoic acid, 4-ethyl-.alpha.-oxo- | 128437-94-5 | 2A-9063203 |
| Benzenepropanoic acid, 4-(1-methylethyl)-.alpha.-oxo- | 112805-46-6 | 2A-9063204 |
| Benzenepropanoic acid, 4-amino-.alpha.-oxo- | 16921-36-1 | 2A-9063205 |
| Benzenepropanoic acid, 4-cyano-.alpha.-oxo- | 43229-87-4 | 2A-9063206 |
| Benzenepropanoic acid, 4-(methylthio)-.alpha.-oxo- | 737823-69-7 | 2A-9063208 |
| 2-Propenoic acid, 2-hydroxy-3-[4-(methylsulfonyl)phenyl]- | 862252-59-3 | 2A-9063209 |
| Benzenepropanoic acid, 3-methyl-.alpha.-oxo- | 61676-25-3 | 2A-9063210 |
| Benzenepropanoic acid, 3-fluoro-.alpha.-oxo- | 95041-89-7 | 2A-9063211 |
| Benzenepropanoic acid, 3-chloro-.alpha.-oxo- | 96406-06-3 | 2A-9063212 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA