
CAS Number7442-52-6
Synonyms1,2,3,4-tetrahydro-2-carbomethoxy-1-oxonaphthalene; METHYL 1-OXO-1,2,3,4-TETRAHYDRONAPHTHALENE-2-CARBOXYLATE; methyl 1,2,3,4-tetrahydro-1-oxonaphthalene-2-carboxylate; 5547P; 1-oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid methyl ester; 1,2,3,4-Tetrahydro-1-oxo-2-naphthalincarbonsaeure-methylester; 2-methoxycarbonyl-3,4-dihydro-1(2H)-naphthone; 1-Oxotetrahydronaphthalene-2-carboxylic Acid Methyl Ester
Molecular FormulaC12H12O3
Molecular Weight204.23
Density1.198g/cm3
Boiling Point319.7ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7442-52-6 |
| Catalog No. | 2A-9063144 |
| Chinese Name | 1,2,3,4-四氢-1-氧代-2-萘羧酸甲酯 |
| Synonyms | 1,2,3,4-tetrahydro-2-carbomethoxy-1-oxonaphthalene; METHYL 1-OXO-1,2,3,4-TETRAHYDRONAPHTHALENE-2-CARBOXYLATE; methyl 1,2,3,4-tetrahydro-1-oxonaphthalene-2-carboxylate; 5547P; 1-oxo-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid methyl ester; 1,2,3,4-Tetrahydro-1-oxo-2-naphthalincarbonsaeure-methylester; 2-methoxycarbonyl-3,4-dihydro-1(2H)-naphthone; 1-Oxotetrahydronaphthalene-2-carboxylic Acid Methyl Ester |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 |
| Density | 1.198g/cm3 |
| Boiling Point | 319.7ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2918300090 |
| MDL Number | MFCD00667560 |
| SMILES | COC(=O)C1CCc2ccccc2C1=O |
| InChI | InChI=1S/C12H12O3/c1-15-12(14)10-7-6-8-4-2-3-5-9(8)11(10)13/h2-5,10H,6-7H2,1H3 |
| InChI Key | YDDRYTDEKAPAHE-UHFFFAOYSA-N |
| MSDS | msds/63144_1_7442_52_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Acetamide, 2,2,2-trichloro-N-[2-(trifluoromethyl)phenyl]- | 349416-85-9 | 2A-9063002 |
| Acetamide, 2,2,2-trichloro-N-[3-(trifluoromethyl)phenyl]- | 1939-29-3 | 2A-9063004 |
| Acetamide, 2,2,2-trichloro-N-[4-(trifluoromethyl)phenyl]- | 2107-36-0 | 2A-9063005 |
| 2,2,3,3-Butanetetracarboxylic acid, 1,2,3,4-tetramethyl ester | 5464-22-2 | 2A-9063083 |
| 3-Cyclohexene-1-carboxylic acid, 2-oxo-, methyl ester | 127943-91-3 | 2A-9063143 |
| Cyclopentanecarboxylic acid, 3-methyl-2-oxo-, methyl ester | 57964-61-1 | 2A-9063145 |
| 3,5-Cyclohexadiene-1,2-dicarboxylic acid | 22919-28-4 | 2A-9063184 |
| Benzene, 2-(chloromethyl)-1,3,5-triethyl- | 100620-31-3 | 2A-9063191 |
| Benzene, 2-(chloromethyl)-1,3,4,5-tetramethyl- | 29328-87-8 | 2A-9063192 |
| Benzenepropanoic acid, .alpha.-oxo-4-(trifluoromethyl)- | 120658-71-1 | 2A-9063198 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA