
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17431-97-9 |
| Catalog No. | 2A-9062596 |
| Chinese Name | 2-甲基-2-(4-硝基苯氧基)丙酸 |
| Synonyms | 2-methyl-2-(4-nitrophenoxy)propanoic acid; 2-methyl-2-(4-nitrophenoxy)propionic acid; NSC34009; IVK/4021352 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 194.23 |
| Density | 1.328g/cm3 |
| Boiling Point | 394.3ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329782070 |
| MDL Number | MFCD01695484 |
| SMILES | Cc1ccc(OC(C)(C)C(O)=O)cc1 |
| InChI | 1S/C11H14O3/c1-8-4-6-9(7-5-8)14-11(2,3)10(12)13/h4-7H,1-3H3,(H,12,13) |
| InChI Key | OQUCRQLGCRZSBH-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/62596_1_17431_97_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Propanoic acid, 2-methyl-2-(2,4,6-trichlorophenoxy)- | 53625-00-6 | 2A-9062591 |
| Pentamycin | 2A-153748 | 2A-9062592 |
| Propanoic acid, 2-(2,6-dichlorophenoxy)-2-methyl- | 16740-71-9 | 2A-9062593 |
| Propanoic acid, 2-(2-fluorophenoxy)-2-methyl- | 605680-35-1 | 2A-9062594 |
| Propanoic acid, 2-(3-fluorophenoxy)-2-methyl- | 605680-36-2 | 2A-9062595 |
| Propanoic acid, 2-(4-cyanophenoxy)-2-methyl- | 79925-16-9 | 2A-9062597 |
| Alanine, 2-methyl-N-phenyl- | 59081-61-7 | 2A-9062598 |
| Alanine, 2-methyl-N-p-tolyl- | 117755-94-9 | 2A-9062599 |
| Alanine, 2-methyl-N-m-tolyl- | 117755-93-8 | 2A-9062600 |
| Alanine, 2-methyl-N-(2-methylphenyl)- | 117755-95-0 | 2A-9062601 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA