
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1914-66-5 |
| Catalog No. | 2A-9062590 |
| Chinese Name | 2-(2,4-二氯苯氧基)-2-甲基丙酸 |
| Synonyms | 2,6-dihydroxybenzoic acid |
| Molecular Formula | C18H18O3N2 |
| Molecular Weight | 310.35 |
| Density | 1.372g/cm3 |
| Boiling Point | 353.2ºC at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD03426212 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H10Cl2O3/c1-10(2,9(13)14)15-8-4-3-6(11)5-7(8)12/h3-5H,1-2H3,(H,13,14) |
| InChI Key | DVCPZLUILSFNDO-UHFFFAOYSA-N |
| MSDS | msds/62590_1_1914_66_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1H-Pyrrole-2,5-dione, 1-(2,4-dichlorophenyl)- | 26396-57-6 | 2A-9062527 |
| 1H-Pyrrole-2,5-dione, 1-(2,4-dibromophenyl)- | 161584-61-8 | 2A-9062531 |
| 1H-Pyrrole-2,5-dione, 1-(2,4-dimethoxyphenyl)- | 67154-42-1 | 2A-9062550 |
| Benzeneacetic acid, 2,4-dichloro-.alpha.-formyl-, ethyl ester | 188425-04-9 | 2A-9062569 |
| Propanoic acid, 2-(2,4-dimethylphenoxy)-2-methyl- | 102416-45-5 | 2A-9062586 |
| Pyrimidine, 2,4-dichloro-6-ethyl- | 6554-65-0 | 2A-9062626 |
| 3-Oxabicyclo[3.2.1]octane-2,4-dione, 1-chloro-5,8,8-trimethyl-, (1R)- (9CI) | 87859-84-5 | 2A-9062670 |
| Benzoic acid, 5-bromo-2,4-dihydroxy- | 7355-22-8 | 2A-9062729 |
| 3-Phenyl-1H,3H-quinazoline-2,4-dione | 603-23-6 | 2A-9062795 |
| Acetamide, N-[(2,4-dimethylphenyl)methyl]- | 74564-04-8 | 2A-9062851 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA