CAS Number5814-37-9
Synonymsethyl 2,4-dioxo-4-p-tolylbutanoate; 2,4-Dioxo-4-p-tolyl-buttersaeure-aethylester; Ethyl 4-methyl-a,g-dioxo-benzenebutanoate; Benzenebutanoic acid, 4-methyl-α,γ-dioxo-, ethyl ester; Ethyl 4-(4-methylphenyl)-2,4-dioxobutanoate; 2,4-dioxo-4-p-tolyl-butyric acid ethyl ester
Molecular FormulaC13H14O4
Molecular Weight234.25
Density1.1±0.1 g/cm3
Boiling Point369.7±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5814-37-9 |
| Catalog No. | 2A-9062379 |
| Chinese Name | 2,4-二氧代-4-(对甲苯)丁酸乙酯 |
| Synonyms | ethyl 2,4-dioxo-4-p-tolylbutanoate; 2,4-Dioxo-4-p-tolyl-buttersaeure-aethylester; Ethyl 4-methyl-a,g-dioxo-benzenebutanoate; Benzenebutanoic acid, 4-methyl-α,γ-dioxo-, ethyl ester; Ethyl 4-(4-methylphenyl)-2,4-dioxobutanoate; 2,4-dioxo-4-p-tolyl-butyric acid ethyl ester |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 369.7±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918300090 |
| MDL Number | MFCD03411526 |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(C)cc1 |
| InChI Key | QQMYOPVSVNPECO-UHFFFAOYSA-N |
| MSDS | msds/62379_1_5814_37_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Polymer Intermediates | ||
|---|---|---|
| Methoxyethoxyethyl acrylate | 7328-18-9 | 2A-9061931 |
| Benzenebutanoic acid, .alpha.,.gamma.-dioxo-, ethyl ester | 6296-54-4 | 2A-9062375 |
| Benzenebutanoic acid, 4-fluoro-.alpha.,.gamma.-dioxo-, ethyl ester | 31686-94-9 | 2A-9062376 |
| Benzenebutanoic acid, 4-bromo-.alpha.,.gamma.-dioxo-, ethyl ester | 40155-54-2 | 2A-9062377 |
| Benzenebutanoic acid, 4-chloro-.alpha.,.gamma.-dioxo-, ethyl ester | 5814-38-0 | 2A-9062378 |
| Benzenebutanoic acid, 3-methyl-.alpha.,.gamma.-dioxo-, ethyl ester | 151646-26-3 | 2A-9062380 |
| Benzenebutanoic acid, 2-methyl-.alpha.,.gamma.-dioxo-, ethyl ester | 741286-44-2 | 2A-9062381 |
| Benzenebutanoic acid, 2-chloro-.alpha.,.gamma.-dioxo-, ethyl ester | 338982-35-7 | 2A-9062382 |
| Pentonic acid, 2-acetyl-2,3-dideoxy-5-O-(phenylmethyl)-, .gamma.-lactone (9CI) | 92920-38-2 | 2A-9063099 |
| DammarenediolII | 14351-29-2 | 2A-9065841 |
| Browse all Polymer Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS