CAS Number893643-18-0
SynonymsEthyl 5,5,5-trifluoro-2,4-dioxopentanoate; Ethyl 5,5,5-Trifluoro-2,4-dioxo-pentanoate; trifluoroacetylpyruvate d'ethyle; Pentanoic acid, 5,5,5-trifluoro-2,4-dioxo-, ethyl ester
Molecular FormulaC7H7F3O4
Molecular Weight212.123
Density1.3±0.1 g/cm3
Boiling Point198.1±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 893643-18-0 |
| Catalog No. | 2A-9062374 |
| Chinese Name | 5,5,5-三氟-2,4-二氧代戊酸乙酯 |
| Synonyms | Ethyl 5,5,5-trifluoro-2,4-dioxopentanoate; Ethyl 5,5,5-Trifluoro-2,4-dioxo-pentanoate; trifluoroacetylpyruvate d'ethyle; Pentanoic acid, 5,5,5-trifluoro-2,4-dioxo-, ethyl ester |
| Molecular Formula | C7H7F3O4 |
| Molecular Weight | 212.123 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 198.1±35.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2918300090 |
| SMILES | CCOC(=O)C(=O)CC(=O)C(F)(F)F |
| InChI Key | ZFRNSFONDYEARZ-UHFFFAOYSA-N |
| MSDS | msds/62374_1_893643_18_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Benzene, 1-cyclopropyl-2,4-dimethyl- | 27546-47-0 | 2A-9062305 |
| 2-Propenoic acid, 3-(2,4-dichlorophenyl)-2-methyl- | 103754-42-3 | 2A-9062308 |
| 1H-Imidazole, 2-(2,4-dimethylphenyl)-4,5-dihydro- | 124730-02-5 | 2A-9062317 |
| 1H-Imidazole, 2-(2,4-dichlorophenyl)-4,5-dihydro- | 61033-72-5 | 2A-9062324 |
| Benzenemethanol, 2,4-dimethyl-.alpha.-(trichloromethyl)- | 861600-36-4 | 2A-9062363 |
| 1,3,5-Triazine-2,4-diamine, 6-(4-chlorophenyl)- | 4514-53-8 | 2A-9062389 |
| 1,3,5-Triazine-2,4-diamine, 6-(4-bromophenyl)- | 30508-74-8 | 2A-9062390 |
| 1,3,5-Triazine-2,4-diamine, 6-(4-fluorophenyl)- | 30530-44-0 | 2A-9062391 |
| 1,3,5-Triazine-2,4-diamine, 6-(4-methylphenyl)- | 19338-12-6 | 2A-9062392 |
| 1,3,5-Triazine-2,4-diamine, 6-(2,4-dimethylphenyl)- | 1186648-07-6 | 2A-9062393 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS