![Oxirane, 2-[(3-methylphenoxy)methyl]- structure, CAS 2186-25-6](/structures/80000/62260_1_2186_25_6.png)
CAS Number2186-25-6
Synonyms2-[(3-Methylphenoxy)methyl]oxirane; m-Cresyl glycidyl ether; 3-methylphenyl glycidyl ether; ((m-tolyloxy)methyl)oxirane; META-CRESYLGLYCIDYLETHER; 2-m-Tolyloxy-methyl-oxirane; m-Tolylglycidyl ether; m-Methylphenylglycidyl ether; 2,3-EPOXY PROPYL-M-TOLYL ETHER; Einecs 218-575-3; 1,2-epoxy-3-m-methylphenoxypropane
Molecular FormulaC10H12O2
Molecular Weight164.2
Density1.1±0.1 g/cm3
Boiling Point260.6±13.0 °C at 760 mmHg
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2186-25-6 |
| Catalog No. | 2A-9062260 |
| Chinese Name | 1,2-环氧基-3-(3-甲基苯氧基丙烷) |
| Synonyms | 2-[(3-Methylphenoxy)methyl]oxirane; m-Cresyl glycidyl ether; 3-methylphenyl glycidyl ether; ((m-tolyloxy)methyl)oxirane; META-CRESYLGLYCIDYLETHER; 2-m-Tolyloxy-methyl-oxirane; m-Tolylglycidyl ether; m-Methylphenylglycidyl ether; 2,3-EPOXY PROPYL-M-TOLYL ETHER; Einecs 218-575-3; 1,2-epoxy-3-m-methylphenoxypropane |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 260.6±13.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | room temperature, inert gas |
| HTC | 2910900090 |
| MDL Number | MFCD00046990 |
| SMILES | Cc1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C10H12O2/c1-8-3-2-4-9(5-8)11-6-10-7-12-10/h2-5,10H,6-7H2,1H3 |
| InChI Key | WYAFQPYCJBLWAS-UHFFFAOYSA-N |
| MSDS | msds/62260_1_2186_25_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Bromo-6-methoxy-1H-indole | 393553-55-4 | 2A-9062186 |
| 2,5-Dichlorobenzimidazole | 4887-95-0 | 2A-9062191 |
| 4-Pyridinecarboxamide, N-(2,6-dimethylphenyl)- | 68280-05-7 | 2A-9062193 |
| 6-Methoxy-4-chromanone | 5802-17-5 | 2A-9062205 |
| 1,3,5-Triazine-2-methanol, 4,6-diamino- | 10603-03-6 | 2A-9062251 |
| 1H-Imidazole-1-ethanol, .alpha.-phenyl- | 24155-47-3 | 2A-9062261 |
| 1H-Imidazole, 2-(4-bromophenyl)-4,5-dihydro- | 705-25-9 | 2A-9062281 |
| 1H-Imidazole, 2-(4-chlorophenyl)-4,5-dihydro- | 13623-52-4 | 2A-9062284 |
| 1H-Imidazole, 2-(3-fluorophenyl)-4,5-dihydro- | 27423-83-2 | 2A-9062288 |
| 1H-Imidazole, 2-(3-bromophenyl)-4,5-dihydro- | 314240-82-9 | 2A-9062289 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA