
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5460-32-2 |
| Catalog No. | 2A-9062120 |
| Chinese Name | 3,4-二甲氧基碘代苯 |
| Synonyms | 4-Iodo-1,2-dimethoxy-benzene; 4-Iodo-1,2-dimethoxybenzene |
| Molecular Formula | C8H9O2I1 |
| Molecular Weight | 264.06 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 272.4±25.0 °C at 760 mmHg |
| Melting Point | 34-35ºC |
| Storage Condition | 2-8°C, protected from light, dry and sealed |
| HTC | 2909309090 |
| MDL Number | MFCD00094416 |
| SMILES | COc1ccc(I)cc1OC |
| InChI | InChI=1S/C8H9IO2/c1-10-7-4-3-6(9)5-8(7)11-2/h3-5H,1-2H3 |
| InChI Key | PUCISUQLWLKKJH-UHFFFAOYSA-N |
| MSDS | msds/62120_1_5460_32_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,2-Benzenediol, 4-ethynyl- | 366808-04-0 | 2A-9062114 |
| 1,3-Benzenediol, 5-ethynyl- | 145078-84-8 | 2A-9062115 |
| Benzene, 1-iodo-4-methoxy-2-nitro- | 58755-70-7 | 2A-9062116 |
| Benzene, 4-fluoro-1,2-dimethoxy- | 398-62-9 | 2A-9062117 |
| Benzene, 4-chloro-1,2-dimethoxy- | 16766-27-1 | 2A-9062118 |
| Benzoic acid, 2-chloro-6-mercapto- | 20324-51-0 | 2A-9062121 |
| Benzoic acid, 4-fluoro-2-mercapto- | 81223-43-0 | 2A-9062122 |
| Benzoic acid, 4-chloro-2-mercapto- | 20324-49-6 | 2A-9062123 |
| Benzoic acid, 5-chloro-2-mercapto- | 20324-50-9 | 2A-9062124 |
| Benzoic acid, 5-bromo-2-mercapto- | 61954-80-1 | 2A-9062125 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA