
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16606-61-4 |
| Catalog No. | 2A-9062072 |
| Chinese Name | 2,4-二氯苯-1,3-二醇 |
| Synonyms | 1,3-Benzenediol,2,4-dichloro; 2,4-Dichloro-1,3-benzenediol; 2,4-Dichlorresorcin |
| Molecular Formula | C6H4Cl2O2 |
| Molecular Weight | 179.00100 |
| Purity | 97 |
| Density | 1.624g/cm3 |
| Boiling Point | 255.1ºC at 760mmHg |
| Storage Condition | 2-8°C, dry and sealed |
| HTC | 2908199090 |
| SMILES | Oc1ccc(Cl)c(O)c1Cl |
| InChI | InChI=1S/C6H4Cl2O2/c7-3-1-2-4(9)5(8)6(3)10/h1-2,9-10H |
| InChI Key | FZIBSPRUZZLSGL-UHFFFAOYSA-N |
| MSDS | msds/62072_1_16606_61_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dimethoxybenzylchloride | 55791-52-1 | 2A-9061839 |
| 3H-Pyrazol-3-one, 5-amino-2,4-dihydro-2-phenyl- | 8215-09-1 | 2A-9061890 |
| Benzene, 1-ethynyl-2,4-dimethoxy- | 77336-36-8 | 2A-9061955 |
| 2,4-Dichloro-6-picoline | 42779-56-6 | 2A-9062017 |
| Benzene, 1-ethynyl-2,4-difluoro- | 302912-34-1 | 2A-9062034 |
| Benzene, 1-ethynyl-2,4-dimethyl- | 16017-30-4 | 2A-9062080 |
| 2,4-Dichloro-6-Nitroquinazoline | 74173-77-6 | 2A-9062137 |
| Methyl 2,4-dichloropyrimidine-5-carboxylate | 3177-20-6 | 2A-9062192 |
| 1,3,5-Triazine-2,4-diamine, 6-(chloromethyl)- | 10581-62-1 | 2A-9062240 |
| 1,3,5-Triazine-2,4-diamine, 6-(dichloromethyl)-N2-phenyl- | 30355-65-8 | 2A-9062242 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA