
CAS Number121-58-4
SynonymsN,N-Dimethyl-sulfanilsaeure; Sulfanilic acid,N-dimethyl; p-N,N-dimethylaminobenzenesulfonic acid; EINECS 204-483-0; 4-dimethylaminobenzenesulfonic acid; N,N-Dimethylsulfanilic acid
Molecular FormulaC8H11O3N1S1
Molecular Weight201.25
Density1.339g/cm3
Melting Point270.5°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121-58-4 |
| Catalog No. | 2A-9061970 |
| Chinese Name | 4-(二甲基氨基)苯磺酸 |
| Synonyms | N,N-Dimethyl-sulfanilsaeure; Sulfanilic acid,N-dimethyl; p-N,N-dimethylaminobenzenesulfonic acid; EINECS 204-483-0; 4-dimethylaminobenzenesulfonic acid; N,N-Dimethylsulfanilic acid |
| Molecular Formula | C8H11O3N1S1 |
| Molecular Weight | 201.25 |
| Density | 1.339g/cm3 |
| Melting Point | 270.5°C |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2921199090 |
| MDL Number | MFCD20269870 |
| SMILES | CN(C)c1ccc(S(=O)(=O)O)cc1 |
| InChI Key | KZVBBVPCVQEVQK-UHFFFAOYSA-N |
| MSDS | msds/61970_1_121_58_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Benzothiazolamine, 6-chloro-4-fluoro- | 942473-93-0 | 2A-9061963 |
| Benzene, 1-ethynyl-4-(trifluoromethoxy)- | 160542-02-9 | 2A-9061964 |
| 1,4-Di-tert-butyl-2,5-bis(2,2,2-trifluoroethoxy)benzene | 1147737-68-5 | 2A-9061965 |
| 2-Benzothiazolamine, 5-chloro-4-fluoro- | 942473-92-9 | 2A-9061968 |
| 2-Benzothiazolamine, 6-bromo-4-fluoro- | 383131-45-1 | 2A-9061969 |
| Benzene, 1-ethoxy-3-ethynyl- | 922735-06-6 | 2A-9061971 |
| 2-Benzothiazolamine, 7-bromo-4-fluoro- | 942473-90-7 | 2A-9061972 |
| 2-Benzothiazolamine, 4-chloro-6-fluoro- | 210834-98-3 | 2A-9061973 |
| Benzene, 1-ethynyl-3-(trifluoromethoxy)- | 866683-57-0 | 2A-9061975 |
| 2-Benzothiazolamine, 6-bromo-4-chloro- | 81822-77-7 | 2A-9061976 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA