
CAS Number2571-52-0
Synonyms2,4,6-Trimethyl-1-benzonitrile; Mesitonitrile; 2,4,6-trimethyl-benzonitrile; 1,3,5-trimethylbenzonitrile; 2,4,6-trimethylbenzenecarbonitrile; mesitylnitrile; MFCD00016378; Benzonitrile,2,4,6-trimethyl; 2,4,6-Trimethylbenzonitrile; mesityl cyanide
Molecular FormulaC10H11N1
Molecular Weight145.2
Purity98%
Density1.0±0.1 g/cm3
Boiling Point260.3±9.0 °C at 760 mmHg
Melting Point52-53°C
AppearanceWhite to off-white solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2571-52-0 |
| Catalog No. | 2A-9061702 |
| Chinese Name | 2,4,6-三甲基苯甲腈 |
| Synonyms | 2,4,6-Trimethyl-1-benzonitrile; Mesitonitrile; 2,4,6-trimethyl-benzonitrile; 1,3,5-trimethylbenzonitrile; 2,4,6-trimethylbenzenecarbonitrile; mesitylnitrile; MFCD00016378; Benzonitrile,2,4,6-trimethyl; 2,4,6-Trimethylbenzonitrile; mesityl cyanide |
| Molecular Formula | C10H11N1 |
| Molecular Weight | 145.2 |
| Purity | 98 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 260.3±9.0 °C at 760 mmHg |
| Melting Point | 52-53°C |
| Appearance | White to off-white solid |
| Storage Condition | Sealed in a cool, dry environment. |
| Packaging | III |
| HTC | 2926909090 |
| MDL Number | MFCD00016378 |
| SMILES | Cc1cc(C)c(C#N)c(C)c1 |
| InChI | InChI=1S/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
| InChI Key | SNIZBGQMWRHNDY-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/61702_1_2571_52_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5(4H)-Oxazolone, 4-[(2-methoxyphenyl)methylene]-2-methyl- | 74169-01-0 | 2A-9061695 |
| Benzonitrile, 4-hydroxy-3,5-dinitro- | 2315-80-2 | 2A-9061696 |
| 5(4H)-Oxazolone, 2-methyl-4-[(3-methylphenyl)methylene]- | 78311-97-4 | 2A-9061697 |
| Benzonitrile, 2,6-dimethyl- | 6575-13-9 | 2A-9061699 |
| 5(4H)-Oxazolone, 4-[(3-chlorophenyl)methylene]-2-methyl- | 57689-69-7 | 2A-9061701 |
| 2-(Phenylmethylene)hexanal | 7492-44-6 | 2A-9061703 |
| 5(4H)-Oxazolone, 4-[(3-bromophenyl)methylene]-2-methyl- | 906722-01-8 | 2A-9061704 |
| Tert-butyl 2-(piperazin-1-yl)acetate | 112257-22-4 | 2A-9061706 |
| 5(4H)-Oxazolone, 4-[(3-fluorophenyl)methylene]-2-methyl- | 85986-89-6 | 2A-9061707 |
| 6-Amino-5-bromonicotinic acid | 180340-69-6 | 2A-9061708 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA