CAS Number620-80-4
SynonymsEthyl (2Z)-2-benzylidene-3-oxobutanoate; Ethyl 2-benzylideneacetoacetate; 2-Acetyl-3-phenylpropenoic acid ethyl ester; ethyl 2-benzylidene-3-oxobutanoate; 2-Benzylidene-3-oxobutanoic acid ethyl ester; 2-Acetyl-3-phenylacrylic acid ethyl ester; ethyl acetobenzylidene acetate; Ethyl (2E)-2-benzylidene-3-oxobutanoate; 2-Benzylidene-3-oxobutyric acid ethyl ester; 2-benzylideneacetoacetic acid ethyl ester
Molecular FormulaC13H14O3
Molecular Weight218.25
Purity97%
Density1.1±0.1 g/cm3
Boiling Point296.0±0.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 620-80-4 |
| Catalog No. | 2A-9061621 |
| Chinese Name | 2-苯亚甲基乙酰乙酸乙酯 |
| Synonyms | Ethyl (2Z)-2-benzylidene-3-oxobutanoate; Ethyl 2-benzylideneacetoacetate; 2-Acetyl-3-phenylpropenoic acid ethyl ester; ethyl 2-benzylidene-3-oxobutanoate; 2-Benzylidene-3-oxobutanoic acid ethyl ester; 2-Acetyl-3-phenylacrylic acid ethyl ester; ethyl acetobenzylidene acetate; Ethyl (2E)-2-benzylidene-3-oxobutanoate; 2-Benzylidene-3-oxobutyric acid ethyl ester; 2-benzylideneacetoacetic acid ethyl ester |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 |
| Purity | 97 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 296.0±0.0 °C at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918300090 |
| MDL Number | MFCD00521137 |
| SMILES | CCOC(=O)C(=Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C13H14O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-9H,3H2,1-2H3/b12-9- |
| InChI Key | AYZGINZXVVKWKV-FMIVXFBMSA-N |
| MSDS | msds/61621_1_620_80_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Methylsulfonyl)-1-phenylethanone | 3708-04-1 | 2A-9061616 |
| 2-Benzylidenemalononitrile | 2700-22-3 | 2A-9061617 |
| (E)-Methyl 2-cyano-3-phenylacrylate | 3695-84-9 | 2A-9061618 |
| (E)-2-Cyano-3-phenylacrylamide | 709-79-5 | 2A-9061619 |
| Diethyl benzylidenemalonate | 5292-53-5 | 2A-9061620 |
| 2-(2H-Pyran-4(3H,5H,6H)-ylidene)malononitrile | 62702-83-4 | 2A-9061622 |
| 2-(2H-Thiopyran-4(3H,5H,6H)-ylidene)malononitrile | 62702-80-1 | 2A-9061623 |
| 3-Hydroxy-4-methoxymandelic acid | 3695-24-7 | 2A-9061628 |
| 3-Oxopentanoic acid | 10191-25-0 | 2A-9061630 |
| Tert-butyl N-[(4-formylphenyl)methyl]Carbamate | 156866-52-3 | 2A-9061634 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS