
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 68520-00-3 |
| Catalog No. | 2A-9061613 |
| Chinese Name | 1-(6-二甲胺基萘-2-基)乙酮 |
| Synonyms | Acdan; BB0; Acedan; 6-acetyl-2-dimethylaminonaphthalene |
| Molecular Formula | C14H15O1N1 |
| Molecular Weight | 213.28 |
| Purity | 98% |
| Density | 1.105g/cm3 |
| Boiling Point | 373.832ºC at 760 mmHg |
| Appearance | Yellow crystalline solid |
| Storage Condition | room temperature |
| HTC | 2922399090 |
| MDL Number | MFCD12024642 |
| SMILES | CC(=O)c1ccc2cc(N(C)C)ccc2c1 |
| InChI Key | FUVQYVZTQJOEQT-UHFFFAOYSA-N |
| MSDS | msds/61613_1_68520_00_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Bromo-3-hydroxypropan-2-one | 38987-72-3 | 2A-9061605 |
| 5-Hydroxy-7-methyl-2,3-dihydronaphthalene-1,4-dione | 14787-38-3 | 2A-9061606 |
| 5-Bromo-1H-inden-2(3H)-one | 174349-93-0 | 2A-9061608 |
| 4,6-Dichloropicolinic acid | 88912-25-8 | 2A-9061609 |
| 4-(2-Naphthyl)-4-oxobutanoicacid | 1590-22-3 | 2A-9061612 |
| Cyclohexyl isocyanide | 931-53-3 | 2A-9061615 |
| 2-(Methylsulfonyl)-1-phenylethanone | 3708-04-1 | 2A-9061616 |
| 2-Benzylidenemalononitrile | 2700-22-3 | 2A-9061617 |
| (E)-Methyl 2-cyano-3-phenylacrylate | 3695-84-9 | 2A-9061618 |
| (E)-2-Cyano-3-phenylacrylamide | 709-79-5 | 2A-9061619 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA