
CAS Number254877-67-3
Synonyms5-chloro-2-(5-chlorothiophene-2-sulfonylamino)-N-(4-(morpholine-4-sulfonyl)phenyl)benzamide; 5-Chloro-2-{[(5-chloro-2-thienyl)sulfonyl]amino}-N-[4-(4-morpholinylsulfonyl)phenyl]benzamide; hmr 1766; ataciguat
Molecular FormulaC21H19O6N3Cl2S3
Molecular Weight576.5
Purity98%
Density1.6±0.1 g/cm3
AppearanceWhite to light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 254877-67-3 |
| Catalog No. | 2A-9061507 |
| Chinese Name | 阿他西呱 |
| Synonyms | 5-chloro-2-(5-chlorothiophene-2-sulfonylamino)-N-(4-(morpholine-4-sulfonyl)phenyl)benzamide; 5-Chloro-2-{[(5-chloro-2-thienyl)sulfonyl]amino}-N-[4-(4-morpholinylsulfonyl)phenyl]benzamide; hmr 1766; ataciguat |
| Molecular Formula | C21H19O6N3Cl2S3 |
| Molecular Weight | 576.5 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Appearance | White to light yellow powder |
| Storage Condition | 2-8°C |
| Application | Ataxelca (HMR-1766) is a nitric oxide-independent activator of soluble guanylyl cyclase (sGC). Ataxuegua can activate the heme iron redox form of sGC and stimulate the production of cyclic GMP (cGMP). |
| MDL Number | MFCD09837865 |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cc(Cl)ccc1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H19Cl2N3O6S3/c22-14-1-6-18(25-34(28,29)20-8-7-19(23)33-20)17(13-14)21(27)24-15-2-4-16(5-3-15)35(30,31)26-9-11-32-12-10-26/h1-8,13,25H,9-12H2,(H,24,27) |
| InChI Key | PQHLRGARXNPFCF-UHFFFAOYSA-N |
| MSDS | msds/61507_1_254877_67_3.pdf |
| Transport Info | Product name: Ataciguat |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2'-O-TBDMS-5'-O-DMT-N4-Ac cytidin | 121058-85-3 | 2A-9061498 |
| 1-Methyl-3-oxetanamine | 952182-03-5 | 2A-9061503 |
| 2-methoxy-N-[2-nitro-5-(phenylthio)phenyl]acetamide | 63470-85-9 | 2A-9061504 |
| LEVOSIMENDAN | 141505-33-1 | 2A-9061505 |
| 4-[N-(4-Carboxybutyl)-N-[2-[2-[4-(2-phenylethyl)benzyloxy]phenyl]ethyl]aMinoMethyl]benzoic acid | 329773-35-5 | 2A-9061506 |
| 1-(2,3-epoxypropoxy)-2,2-bis[(2,3-epoxypropoxy)methyl]butane | 3454-29-3 | 2A-9061508 |
| bis(2-ethylhexyl) tetrabromophthalate | 26040-51-7 | 2A-9061509 |
| DEOXYNIVALENOL | 51481-10-8 | 2A-0201785 |
| Di-Potassiun hydrogen phosphate | 2A-153010 | 2A-9061511 |
| 3,8-DINITRO-6-PHENYLPHENANTHRIDINE | 82921-86-6 | 2A-9061512 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA