
CAS Number526-94-3
SynonymsEINECS 208-400-9; Monosodium tartrate; Sodium bitartrate; MFCD00065393; Sodium hydrogen tartrate; Sodium 3-carboxy-2,3-dihydroxypropanoate; Butanedioic acid, 2,3-dihydroxy-, sodium salt (1:1); Sodium bitartrate monohydrate; sodium,2,3,4-trihydroxy-4-oxobutanoate
Molecular FormulaNaO2CCH(OH)CH(OH)CO2H
Molecular Weight172.07
Purity98%
Boiling Point399.3ºC at 760mmHg
Melting Point253 °C (dec.) (lit.)
Appearancesolid
EINECS208-400-9
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 526-94-3 |
| Catalog No. | 2A-9061432 |
| Chinese Name | 酒石酸氢钠 |
| Synonyms | EINECS 208-400-9; Monosodium tartrate; Sodium bitartrate; MFCD00065393; Sodium hydrogen tartrate; Sodium 3-carboxy-2,3-dihydroxypropanoate; Butanedioic acid, 2,3-dihydroxy-, sodium salt (1:1); Sodium bitartrate monohydrate; sodium,2,3,4-trihydroxy-4-oxobutanoate |
| Molecular Formula | NaO2CCH(OH)CH(OH)CO2H |
| Molecular Weight | 172.07 |
| Purity | 98 |
| Boiling Point | 399.3ºC at 760mmHg |
| Melting Point | 253 °C (dec.) (lit.) |
| Appearance | solid |
| Water Solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| Storage Condition | 1. Store in a cool, dry and well-ventilated wareho |
| EINECS | 208-400-9 |
| HTC | 2918199090 |
| PubChem ID | 329753305 |
| MDL Number | MFCD00065393 |
| SMILES | [Na+].O[C@H]([C@@H](O)C([O-])=O)C(O)=O |
| InChI | 1S/C4H6O6.Na/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-1/t1-,2-;/m1./s1 |
| InChI Key | NKAAEMMYHLFEFN-ZVGUSBNCSA-M |
| Beilstein/REAXYS | 6099125 |
| NACRES Code | NA.22 |
| UNSPSC | 51113400 |
| MSDS | msds/61432_1_526_94_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methiopropamine | 801156-47-8 | 2A-9061422 |
| BENZALKONIUM CHLORIDE | 68424-85-1 | 2A-9061428 |
| Unii-p9vxv1408y | 866021-48-9 | 2A-9061429 |
| Pregna-1,4-diene-3,20-dione, 11,17-dihydroxy-21-(sulfooxy)-, monosodium salt, (11beta)- | 3664-95-7 | 2A-9061430 |
| GANODERIC ACID C2 | 103773-62-2 | 2A-9061431 |
| 3-[2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propoxy]-1-isopropylamino-2-propanol | 163685-37-8 | 2A-9061433 |
| DMSA | 4710-17-2 | 2A-9061434 |
| N-(n-Butyl)phosphoric Triamide | 25316-39-6 | 2A-9061435 |
| Dehydro Effusol | 137319-34-7 | 2A-9061436 |
| EFFUSOL | 73166-28-6 | 2A-9061437 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA