
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 102130-43-8 |
| Catalog No. | 2A-9061421 |
| Chinese Name | 苍术苷二钾盐 |
| Synonyms | ATRACTYLOSIDE,DIPOTASSIUM SALT,ATRACTYLIS GUMMIFERA; Atractyloside Dipotassium Salt; ATR,2K; MFCD00078810 |
| Molecular Formula | C30H44K2O16S2 |
| Molecular Weight | 802.987 |
| Purity | 98 |
| Appearance | solid |
| Storage Condition | Store airtight in a cool, dry warehouse. Refrigera |
| Application | Atractyloside potassium salt is a toxic diterpene glycoside compound isolated from the fruit of Atractylodes. It is a highly efficient and specific inhibitor of mitochondrial ADP/ATP transport. Atract |
| SMILES | C=C1C2CCC3C4(C)CC(OC5OC(CO)C(OS(=O)(=O)[O-])C(OS(=O)(=O)[O-])C5OC(=O)CC(C)C)CC(C(=O)O)C4CCC3(C2)C1O.[K+].[K+] |
| InChI | InChI=1S/C30H46O16S2.2K/c1-14(2)9-22(32)44-25-24(46-48(39,40)41)23(45-47(36,37)38)20(13-31)43-28(25)42-17-10-18(27(34)35)19-7-8-30-11-16(15(3)26(30)33)5-6-21(30)29(19,4)12-17;;/h14,16-21,23-26,28,31,33H,3,5-13H2,1-2,4H3,(H,34,35)(H,36,37,38)(H,39,40,41);;/q;2*+1/p-2/t16?,17-,18-,19-,20?,21+,23?,24?,25?,26+,28?,29-,30-;;/m1../s1 |
| InChI Key | IUCNQFHEWLYECJ-UHFFFAOYSA-L |
| Hazard Symbols | 6.1(a) |
| Transport Info | Product name: Atractyloside potassium salt |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| MAGNESIUM OLEATE | 1555-53-9 | 2A-9061415 |
| SODIUM PALMITATE | 408-35-5 | 2A-9061416 |
| CALCIUM PALMITATE | 542-42-7 | 2A-9061417 |
| MAGNESIUM PALMITATE | 2A-152918 | 2A-9061418 |
| Dextranomer | 2A-352919 | 2A-9061419 |
| Methiopropamine | 801156-47-8 | 2A-9061422 |
| BENZALKONIUM CHLORIDE | 68424-85-1 | 2A-9061428 |
| Unii-p9vxv1408y | 866021-48-9 | 2A-9061429 |
| Pregna-1,4-diene-3,20-dione, 11,17-dihydroxy-21-(sulfooxy)-, monosodium salt, (11beta)- | 3664-95-7 | 2A-9061430 |
| GANODERIC ACID C2 | 103773-62-2 | 2A-9061431 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA