
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35205-54-0 |
| Catalog No. | 2A-9061083 |
| Chinese Name | 1-苯氧基丙-2-胺 |
| Synonyms | 1-Phenoxypropan-2-amine; 1-phenoxypropan-2-amine |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.671 |
| Purity | 98% |
| Density | 1.004g/cm3 |
| Boiling Point | 240.5ºC at 760mmHg |
| Storage Condition | 2-8°C, protected from light, inert gas |
| HTC | 2922299090 |
| MDL Number | MFCD08063781 |
| SMILES | CC(N)COc1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3 |
| InChI Key | IKYFHRVPKIFGMH-UHFFFAOYSA-N |
| MSDS | msds/61083_1_35205_54_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| discodermolide | 127943-53-7 | 2A-9061060 |
| 4-(Diethoxymethyl)-1-ethoxy-2-methoxybenzene | 72797-28-5 | 2A-9061066 |
| 1,1-Dichlorodimethyl ether | 4885-02-3 | 2A-9061071 |
| 2,3-DIBROMO-2-CHLORO-1,1,1,4,4,4-HEXAFLUOROBUTANE | 63573-66-0 | 2A-9061074 |
| 2,3-DIBROMO-1,1,1,4,4,4-HEXAFLUOROBUTANE | 384-50-9 | 2A-9061075 |
| nickel hexafluorosilicate | 26043-11-8 | 2A-9061084 |
| aluminium hexafluorosilicate | 17099-70-6 | 2A-9061085 |
| ALUMINA | 1333-84-2 | 2A-9061097 |
| GLYCINE, N-(MERCAPTOACETYL)GLYCYLGLYCYL- | 66516-09-4 | 2A-9061100 |
| Cytosine | 71--30-7 | 2A-9061101 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA