
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56190-17-1 |
| Catalog No. | 2A-9006100 |
| Chinese Name | 4-丙氧基-1,2-二胺苯 |
| Synonyms | MFCD00462576; 4-propoxy-o-phenylenediamine; EINECS 260-044-3; 4-n-propoxy-o-phenylenediamine; 4-Propoxy-1,2-diaminobenzene |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22000 |
| Purity | 98 |
| Density | 1.1 g/cm3 |
| Boiling Point | 324.2ºC at 760 mmHg |
| EINECS | 260-044-3 |
| HTC | 2922299090 |
| SMILES | CCCOc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C9H14N2O/c1-2-5-12-7-3-4-8(10)9(11)6-7/h3-4,6H,2,5,10-11H2,1H3 |
| InChI Key | UUAOMJOZLSTWIP-UHFFFAOYSA-N |
| MSDS | msds/6100_1_56190_17_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Phenylbutylphosphonous acid | 2A-106091 | 2A-9006091 |
| 4-Phenylenediamine dihydrochloride | 541-69-5 | 2A-9006092 |
| 4-Phenyliminobutane-1,2,3-triol | 2A-106093 | 2A-9006093 |
| 4-Phthalodinitrile | 623-26-7 | 2A-9006095 |
| 4-Piperidone | 41661-47-6 | 2A-9006098 |
| 4-Pyridol | 108-96-3 | 2A-9006106 |
| 4-Pyridylacetic acid hydrochloride | 6622-91-9 | 2A-9006107 |
| 4-Pyridylacetonitrile hydrochloride | 92333-25-0 | 2A-9006108 |
| 4-Pyridylmercaptoacetyl chloride hydrochloride | 27230-51-9 | 2A-9006109 |
| 4-tert-Butyl-1-chloro-2-nitrobenzene | 58574-05-3 | 2A-9006115 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA