
CAS Number203-33-8
SynonymsBenzo<b>fluoroanthene; 1,2-Benzofluoranthene; Benz[a]aceanthrylene; Benzo<b>fluoroanthen; Benzo[a]aceanthrylene; 1,2-Benzfluoranthrene; 1,2-Benzfluoranthene; Benzo<b>fluoranthene
Molecular FormulaC20H12
Molecular Weight252.309
Purity98%
Density1.3±0.1 g/cm3
Boiling Point467.5±12.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 203-33-8 |
| Catalog No. | 2A-9060950 |
| Chinese Name | 苯并(A)荧蒽 |
| Synonyms | Benzo<b>fluoroanthene; 1,2-Benzofluoranthene; Benz[a]aceanthrylene; Benzo<b>fluoroanthen; Benzo[a]aceanthrylene; 1,2-Benzfluoranthrene; 1,2-Benzfluoranthene; Benzo<b>fluoranthene |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.309 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 467.5±12.0 °C at 760 mmHg |
| Storage Condition | Ventilated and low temperature drying |
| HTC | 2902909090 |
| SMILES | c1ccc2c(c1)-c1cccc3cc4ccccc4c-2c13 |
| InChI | InChI=1S/C20H12/c1-2-8-15-13(6-1)12-14-7-5-11-17-16-9-3-4-10-18(16)20(15)19(14)17/h1-12H |
| InChI Key | OQDXASJSCOTNQS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 2.0%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2902909090 other aromatic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 2.0%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| CINNAMON | 2A-152469 | 2A-9060945 |
| Cocoa Powder | 2A-152470 | 2A-9060946 |
| Sarsaparilla | 2A-152471 | 2A-9060947 |
| Catuaba | 2A-152472 | 2A-9060948 |
| BENZO(K)FLUORANTHENE | 207-08-9 | 2A-9060949 |
| Benzenemethanaminium, N,N-dimethyl-N-octadecyl-, chloride, reaction products with hectorite | 94891-33-5 | 2A-9060953 |
| STEARALKONIUM HECTORITE | 12691-60-0 | 2A-9060954 |
| Quaternary ammonium compounds, benzyl(hydrogenated tallow alkyl)dimethyl, chlorides, compds. with hectorite | 71011-26-2 | 2A-9060955 |
| 3-FLUORO-3-METHOXY(1,1-BIPHENYL) -4-AMINE | 2A-152480 | 2A-9060956 |
| 2,3-dichlorobuta-1,3-diene | 1653-19-6 | 2A-9060957 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA