
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 77968-17-3 |
| Catalog No. | 2A-9000608 |
| Chinese Name | 1,1,1,3,5,5,5-七氟代戊烷-2,4-二酮 |
| Synonyms | MFCD00153187; 1,1,1,3,5,5,5-heptafluoropentane-2,4-dione |
| Molecular Formula | C5HF7O2 |
| Molecular Weight | 226.04900 |
| Purity | 97 |
| Density | 1.57g/cm3 |
| Boiling Point | 70-72°C |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | II |
| HTC | 2914700090 |
| SMILES | O=C(C(F)C(=O)C(F)(F)F)C(F)(F)F |
| InChI Key | GRHYFDZMGZYXAP-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 1-(2,4-Difluorophenyl)-2-thiourea | 175277-76-6 | 2A-9000435 |
| 1-(2,4-Difluorophenyl)biguanide hydrochloride | 66088-52-6 | 2A-9000436 |
| 1-(2,4-Difluorophenyl)piperazine | 115761-79-0 | 2A-9000437 |
| 1-(2,4-Dihydroxyphenyl)-2-phenylethan-1-one | 3669-41-8 | 2A-9000438 |
| 1-(2,4-Dimethoxyphenyl)piperazine | 16015-75-1 | 2A-9000440 |
| 1,1,1,5,5,6,6,7,7,7-Decafluoroheptane -2,4-dione | 20583-66-8 | 2A-9000611 |
| 1,1,1-Trifluoropentane-2,4-dione | 367-57-7 | 2A-9000615 |
| 1,2,4,5-Tetrafluorobenzene | 327-54-8 | 2A-9000666 |
| 1,2-Dibromo-2,4-dicyanobutane | 35691-65-7 | 2A-9000688 |
| 1,3-Bis(2,4-diaminophenoxy)propane tetrahydrochloride | 74918-21-1 | 2A-9000729 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA