
CAS Number121-92-6
SynonymsBenzoic acid,m-nitro; m-Nitrobenzoic acid; EINECS 204-508-5; MFCD00007251; m-Nitrobenzenecarboxylic acid; Metanitrobenzoic acid; 3-Nitro-benzoic acid; Benzoic acid,3-nitro
Molecular FormulaO2NC6H4CO2H
Molecular Weight167.12
Purity99%
Density1.5±0.1 g/cm3
Boiling Point340.7±25.0 °C at 760 mmHg
Melting Point139-141 °C (lit.)
Appearancesolid
EINECS204-508-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 121-92-6 |
| Catalog No. | 2A-9060773 |
| Chinese Name | 间硝基苯甲酸 |
| Synonyms | Benzoic acid,m-nitro; m-Nitrobenzoic acid; EINECS 204-508-5; MFCD00007251; m-Nitrobenzenecarboxylic acid; Metanitrobenzoic acid; 3-Nitro-benzoic acid; Benzoic acid,3-nitro |
| Molecular Formula | O2NC6H4CO2H |
| Molecular Weight | 167.12 |
| Purity | 99 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 340.7±25.0 °C at 760 mmHg |
| Melting Point | 139-141 °C (lit.) |
| Appearance | solid |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| Storage Condition | Pack airtightly and store in a cool and ventilated |
| EINECS | 204-508-5 |
| HTC | 2916399090 |
| PubChem ID | 24850684 |
| MDL Number | MFCD00007251 |
| SMILES | OC(=O)c1cccc(c1)[N+]([O-])=O |
| InChI | 1S/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10) |
| InChI Key | AFPHTEQTJZKQAQ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 908644 |
| NACRES Code | NA.22 |
| eCl@ss | 39032047 |
| UNSPSC | 12352100 |
| MSDS | msds/60773_1_121_92_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethanone, 2-bromo-1-cyclohexyl- (9CI) | 56077-28-2 | 2A-9060765 |
| DL-2-Phenylpropionic acid | 492-37-5 | 2A-9060768 |
| N-(n-Butyl)thiophosphoric triamide | 94317-64-3 | 2A-9060770 |
| 3,4-DIMETHYL-1H-PYRAZOLIUM DIHYDROGEN PHOSPHATE | 202842-98-6 | 2A-9060771 |
| 4-METHYL-1,2,4-TRIAZOLIDINE-3,5-DIONE | 16312-79-1 | 2A-9060772 |
| Keliximab | 174-722-30-6 | 2A-9060774 |
| JOSAMYCIN PROPIONATE | 40922-77-8 | 2A-9060778 |
| 2-OCTYL CYANOACRYLATE | 133978-15-1 | 2A-9060779 |
| 2-ethoxyethyl 2-cyanoacrylate | 21982-43-4 | 2A-9060780 |
| isoamyl 2-cyanoacrylate | 19475-26-4 | 2A-9060781 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA