
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6487-38-3 |
| Catalog No. | 2A-9060728 |
| Chinese Name | 3-羟基丙酸钠盐 |
| Synonyms | sodium,3-hydroxypropanoate |
| Molecular Formula | 3-(NO2)C6H4SO3Na |
| Molecular Weight | 225.15 |
| Purity | 98 |
| Melting Point | 350 °C (decomposition) |
| Appearance | needles |
| Storage Condition | -20°C |
| HTC | 2918199090 |
| MDL Number | MFCD00007490 |
| SMILES | [Na+].[S](=O)(=O)([O-])c1cc(ccc1)[N+](=O)[O-] |
| InChI | 1S/C6H5NO5S.Na/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,10,11,12);/q;+1/p-1 |
| InChI Key | LJRGBERXYNQPJI-UHFFFAOYSA-M |
| NACRES Code | NA.22 |
| UNSPSC | 12352107 |
| MSDS | msds/60728_1_6487_38_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Isooctyl stearate | 40550-16-1 | 2A-9060721 |
| TPEN | 16858-02-9 | 2A-9060722 |
| Fluazolate | 174514-07-9 | 2A-9060723 |
| Benzyl hydroxy(4-phenylbutyl)phosphinoylacetate | 87460-09-1 | 2A-9060726 |
| Primrose Oil | 308064-97-3 | 2A-9060727 |
| 2-cyano-17a-Methyl-17b-hydroxy-androst-3-one | 2A-052255 | 2A-9060730 |
| Mebolazine | 3625-07-8 | 2A-9060731 |
| Androstan-17-ol, 2,3-epithio-17-methyl-, (2a,3a,5a,17b)- | 4267-80-5 | 2A-9060732 |
| 1H-Indazol-6-ol,4-broMo- | 885518-75-2 | 2A-9060735 |
| 2-METHYL-3-OXO-3-PHENYL-PROPIONIC ACID ETHYL ESTER | 10488-87-6 | 2A-9060739 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA