
CAS Number100-16-3
Synonyms4-Nitropheylhydrazine; MFCD00007579; (4-Nitrophenyl)hydrazine; 4-Nitrophenylhydrazine; EINECS 202-824-8; (p-Nitrophenyl)hydrazine
Molecular FormulaC6H7N3O2
Molecular Weight159.09
Purity97 (CP)%
Density1.4±0.1 g/cm3
Boiling Point344.0±25.0 °C at 760 mmHg
Melting Point156 °C (dec.)
Appearancesolid
EINECS202-824-8
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100-16-3 |
| Catalog No. | 2A-9006044 |
| Chinese Name | 4-硝基苯肼 |
| Synonyms | 4-Nitropheylhydrazine; MFCD00007579; (4-Nitrophenyl)hydrazine; 4-Nitrophenylhydrazine; EINECS 202-824-8; (p-Nitrophenyl)hydrazine |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 159.09 |
| Purity | 97 (CP) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 344.0±25.0 °C at 760 mmHg |
| Melting Point | 156 °C (dec.) |
| Appearance | solid |
| Water Solubility | soluble in hot water |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | I |
| EINECS | 202-824-8 |
| HTC | 2928000090 |
| UN(IATA) | UN 3376 |
| PubChem ID | 329762447 |
| MDL Number | MFCD12546036 |
| SMILES | NN[13c]1[13cH][13cH][13c]([13cH][13cH]1)[N+]([O-])=O |
| InChI | 1S/C6H7N3O2/c7-8-5-1-3-6(4-2-5)9(10)11/h1-4,8H,7H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChI Key | KMVPXBDOWDXXEN-IDEBNGHGSA-N |
| UNSPSC | 12352102 |
| Hazard Symbols | 4.1 |
| Risk Codes | R11;R22;R36/37/38;R5 |
| Safety Description | S26;S37/39 |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nitrophenethylamine hydrochloride | 29968-78-3 | 2A-9006034 |
| 4-Nitrophenyl anthranilate | 19176-60-4 | 2A-9006037 |
| 4-Nitrophenyl phenyl sulfide | 952-97-6 | 2A-9006040 |
| 4-Nitrophenyl trifluoroacetate | 658-78-6 | 2A-9006041 |
| 4-Nitrophenylacetate | 830-03-5 | 2A-9006042 |
| 4-Nitrophenylhydrazine hydrochloride | 636-99-7 | 2A-9006045 |
| 4-Nitrophenylisocyanide | 2A-106046 | 2A-9006046 |
| 4-Nitrophenyloxamic acid | 103-94-6 | 2A-9006047 |
| 4-Nitrophenylsulfur pentafluoride | 2613-27-6 | 2A-0202176 |
| 4-Nitrophthalimide | 89-40-7 | 2A-9006049 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA