
CAS Number141625-93-6
SynonymsMultaq Hydrochloride.; Multaq; Dronedarone (Hydrochloride); Dronedarone hydrochloride; Dronedarone HCl
Molecular FormulaC31H45ClN2O5S
Molecular Weight593.22
Purity≥98 (HPLC)%
Boiling Point683.9ºC at 760mmHg
Melting PointNA (low-melting)
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 141625-93-6 |
| Catalog No. | 2A-9060249 |
| Chinese Name | 盐酸决奈达隆 |
| Synonyms | Multaq Hydrochloride.; Multaq; Dronedarone (Hydrochloride); Dronedarone hydrochloride; Dronedarone HCl |
| Molecular Formula | C31H45ClN2O5S |
| Molecular Weight | 593.22 |
| Purity | ≥98 (HPLC) |
| Boiling Point | 683.9ºC at 760mmHg |
| Melting Point | NA (low-melting) |
| Appearance | powder |
| Water Solubility | DMSO: soluble15mg/mL, clear |
| Storage Condition | Refrigerator |
| Application | Dronedarone hydrochloride is a non-iodinated amiodarone derivative that inhibits Na+, K+ and Ca2+ currents. |
| PubChem ID | 329798909 |
| MDL Number | MFCD00914940 |
| SMILES | Cl.CCCCN(CCCC)CCCOc1ccc(cc1)C(=O)c2c(CCCC)oc3ccc(NS(C)(=O)=O)cc23 |
| InChI | 1S/C31H44N2O5S.ClH/c1-5-8-12-29-30(27-23-25(32-39(4,35)36)15-18-28(27)38-29)31(34)24-13-16-26(17-14-24)37-22-11-21-33(19-9-6-2)20-10-7-3;/h13-18,23,32H,5-12,19-22H2,1-4H3;1H |
| InChI Key | DWKVCQXJYURSIQ-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/60249_1_141625_93_6.pdf |
| Transport Info | Product name: Dronedarone hydrochloride |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PHENYL 3-HYDROXYBENZOATE | 24262-63-3 | 2A-9060244 |
| 2-hydroxyethyl benzoate | 94-33-7 | 2A-9060245 |
| 3-methylcyclopentylamine | 52430-83-8 | 2A-9060246 |
| 3-METHOXYPHENYLMAGNESIUM BROMIDE | 36282-40-3 | 2A-9060247 |
| 2-BROMO-3'-HYDROXYACETOPHENONE | 2491-37-4 | 2A-9060248 |
| RARECHEM AH PB 0188 | 216019-35-1 | 2A-9060250 |
| CIS CIS-MUCONIC ACID | 1119-72-8 | 2A-9060256 |
| dipotassium telluride | 12142-40-4 | 2A-9060257 |
| AMRUBICIN | 110267-81-7 | 2A-9060258 |
| Prucalopride | 179474-81-8 | 2A-9060259 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA