
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1003709-80-5 |
| Catalog No. | 2A-9060204 |
| Chinese Name | 2,4-二氟-3,5-二甲氧基苯甲酸 |
| Synonyms | 2,4-Difluoro-3,5-dimethoxybenzoic acid |
| Molecular Formula | C9H8O4F2 |
| Molecular Weight | 218.16 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 363.5±37.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918990090 |
| MDL Number | MFCD09839225 |
| SMILES | COc1cc(C(=O)O)c(F)c(OC)c1F |
| InChI Key | LLRUPRYHYIFLJS-UHFFFAOYSA-N |
| MSDS | msds/60204_1_1003709_80_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| Trifloxystrobin | 141517-21-7 | 2A-9059813 |
| Haloxyfop-P | 95977-29-0 | 2A-9059839 |
| 2,4-DICHLOROFURO[3,2-D]PYRIMIDINE | 956034-07-4 | 2A-9059840 |
| TERT-BUTYL 2,4-DIOXOPIPERIDINE-1-CARBOXYLATE | 845267-78-9 | 2A-9059928 |
| 2,4,5-Trifluorobenzyl bromide | 157911-56-3 | 2A-9060083 |
| 5-(2-Methoxy-benzyl)-pyrimidine-2,4-diamine | 85544-40-7 | 2A-9060254 |
| Flocoumafen | 90035-08-8 | 2A-9060327 |
| tert-Butyl 2,4-dichloro-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate | 1065114-27-3 | 2A-9060570 |
| 2,4,5-TRIMETHOXYBENZYL ALCOHOL | 30038-31-4 | 2A-9060706 |
| 2'-BENZOYL-2,4'-DICHLOROACETANILIDE | 4016-85-7 | 2A-9060716 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA