![4-Nitrobenzyl-(1R,5R,6S)-6-[(1R)-1-hydroxyethyl]-2-[(diphenylphosphono)oxy]-1-methylcarbapen-2-em-3-carboxylic acid structure, CAS 90776-59-3](/structures/20000/6017_3_90776_59_3.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90776-59-3 |
| Catalog No. | 2A-9006017 |
| Chinese Name | 杂氮双环磷酸酯 |
| Synonyms | MFCD01318092 |
| Molecular Formula | C29H27N2O10P |
| Molecular Weight | 594.506 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 722.4±60.0 °C at 760 mmHg |
| Melting Point | 129-131ºC |
| Storage Condition | -20°C Freezer, Under Inert Atmosphere |
| HTC | 2933790090 |
| SMILES | CC(O)C1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)C(C)C12 |
| InChI Key | STULDTCHQXVRIX-PIYXRGFCSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 4-N-(2-Aminoethyl)-1-N-Boc-piperazine | 192130-34-0 | 2A-9005979 |
| 4-N-Boc-2-methylpiperazine | 120737-59-9 | 2A-9005991 |
| 4-N-Boc-4-N-methylaminopiperidine | 108612-54-0 | 2A-9005992 |
| 4-N-Boc-piperazine-2-carboxylic acid | 128019-59-0 | 2A-9005993 |
| 4-Nitrobenzoyl isothiocyanate | 28115-92-6 | 2A-9006015 |
| 4'-Nitrobiphenyl-4-sulfonyl chloride | 20443-75-8 | 2A-9006021 |
| 4-Nitrophenyl isothiocyanate | 2131-61-5 | 2A-9006039 |
| 4-Oxo-3-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1-phthalazine carboxylic acid | 2A-106072 | 2A-9006072 |
| 4-Phenoxyphenyl isocyanate | 59377-19-4 | 2A-9006082 |
| 5-(3-Oxo-3-phenylpropenyl)thiophene-2-sulfonyl chloride | 728864-91-3 | 2A-9006163 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA