
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 885521-80-2 |
| Catalog No. | 2A-9060004 |
| Chinese Name | 4-溴-1H-吲唑-3-甲酸 |
| Synonyms | 4-Bromo-3-indazolecarboxylic acid; 4-Bromo-3-(1H)indazole carboxylic acid; 4-Bromo-1H-indazole-3-carboxylic acid |
| Molecular Formula | C8H5BrN2O2 |
| Molecular Weight | 241.042 |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 493.4±25.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2933990090 |
| SMILES | O=C(O)c1n[nH]c2cccc(Br)c12 |
| InChI Key | IQVZPISNPRYBGH-UHFFFAOYSA-N |
| MSDS | msds/60004_1_885521_80_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ribofuranose (7CI,8CI,9CI) | 15761-67-8 | 2A-9059959 |
| 1-METHYLADENINE | 1670-69-5 | 2A-9059965 |
| 1,2-Piperidinedicarboxylic acid,5-hydroxy-, 1-(1,1-dimethylethyl) 2-methyl ester | 915976-32-8 | 2A-9059970 |
| 4,6-DICHLORO-2-PROPYL-PYRIMIDINE | 1197-28-0 | 2A-9059993 |
| 4-FLUOROPIPERIDINE | 78197-27-0 | 2A-9059995 |
| 1-METHYL-1H-BENZIMIDAZOLE-2-CARBOXYLIC ACID | 20572-01-4 | 2A-9060013 |
| 3-CHLORO-2,4(3H,5H)-FURANDIONE | 4971-55-5 | 2A-9060018 |
| 1,3,5-TRIBENZYLHEXAHYDRO-1,3,5-TRIAZINE | 2547-66-2 | 2A-9060023 |
| 5-[2-Cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-5,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2(4H)-one | 150322-38-6 | 2A-9060027 |
| 3-METHYL-1H-1,2,4-TRIAZOLE | 7170-01-6 | 2A-9060076 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA