
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 588-46-5 |
| Catalog No. | 2A-9059715 |
| Chinese Name | N-乙酰苄胺 |
| Synonyms | EINECS 209-619-2; n-benzylacetamide; MFCD00059204 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 |
| Purity | 98% |
| Density | 1.031g/cm3 |
| Boiling Point | 157 °C / 2mmHg |
| Melting Point | 61°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | room temperature, dry |
| MDL Number | MFCD00059204 |
| SMILES | N(Cc1ccccc1)C(=O)C |
| InChI | InChI=1S/C9H11NO/c1-8(11)10-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,10,11) |
| InChI Key | UZJLYRRDVFWSGA-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 12352200 |
| MSDS | msds/59715_1_588_46_5.pdf |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(3-benzo(b)thienyl)alanine | 1956-23-6 | 2A-9059700 |
| MOLYBDENUM BORIDE | 12006-98-3 | 2A-9059704 |
| Dimethyl-2-oxo-3-phenylpropyl phosphonate | 52343-38-1 | 2A-9059705 |
| Perindropril | 2A-151119 | 2A-9059708 |
| 3-borono-5-hydroxybenzotrifluoride | 957062-66-7 | 2A-9059713 |
| Calcium beta-hydroxy-beta-methylbutyrate | 135236-72-5 | 2A-9059717 |
| 4-[(2-AMINOETHYL)SULFONYL]-PIPERAZINONE | 80-03-8 | 2A-9059720 |
| 2,3-Dichloroaniline | 608-27- 5 | 2A-9059721 |
| Pyrimethamine Micronized | 2A-151134 | 2A-9059723 |
| CHROMOGEN I | 635-35-2 | 2A-9059736 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA