
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5333-27-7 |
| Catalog No. | 2A-9005952 |
| Chinese Name | 4'-甲基-3'-硝基苯乙酮 |
| Synonyms | MFCD00033858; 1-(4-Methyl-3-nitrophenyl)ethanone |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.192 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 256.4±20.0 °C at 760 mmHg |
| Melting Point | 57-61 °C |
| Storage Condition | Keep away from light, cool and dry place, sealed a |
| HTC | 2914700090 |
| MDL Number | MFCD00033885 |
| SMILES | CC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9NO3/c1-6-3-4-8(7(2)11)5-9(6)10(12)13/h3-5H,1-2H3 |
| InChI Key | YRBBMDOBWRUMEZ-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/5952_1_5333_27_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methoxysalicylamide | 6745-77-3 | 2A-9005942 |
| 4-Methoxythiophenol | 696-63-9 | 2A-9005943 |
| 4-Methoxytrityl chloride | 14470-28-1 | 2A-9005944 |
| 4-Methyl-1-phenyl-3-pyrazilidone | 2654-57-1 | 2A-9005946 |
| 4-Methyl-3-benzyloxybenzyl alcohol | 2A-105951 | 2A-9005951 |
| 4-Methyl-3-nitrobenzoyl chloride | 10397-30-5 | 2A-9005953 |
| 4-Methyl-4'-benzoyldiphenyl sulfide | 83846-85-9 | 2A-9005955 |
| 4-Methylbenzotrifluoride | 6140-17-6 | 2A-9005960 |
| 4-Methylcatechol diacetate | 52589-39-6 | 2A-9005963 |
| 4-Methylcinnamic acid | 1866-39-3 | 2A-9005964 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA