![(1R,2R)-2-[[4'-[[(Phenylamino)carbonyl]amino][1,1'-biphenyl]-4-yl]carbonyl]cyclopentanecarboxylic acid structure, CAS 959122-11-3](/structures/60000/59422_1_959122_11_3.png)
CAS Number959122-11-3
Synonyms(1R,2R)-2-({4'-[(Phenylcarbamoyl)amino]-4-biphenylyl}carbonyl)cyclopentanecarboxylic acid; cc-142; (1R,2R)-2-({4'-[(Phenylcarbamoyl)amino]biphenyl-4-yl}carbonyl)cyclopentanecarboxylic acid; A 922500
Molecular FormulaC26H24N2O4
Molecular Weight428.48
Purity>95 (HPLC)%
Density1.3±0.1 g/cm3
Boiling Point576.1±50.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 959122-11-3 |
| Catalog No. | 2A-9059422 |
| Chinese Name | DGAT-1 抑制剂 |
| Synonyms | (1R,2R)-2-({4'-[(Phenylcarbamoyl)amino]-4-biphenylyl}carbonyl)cyclopentanecarboxylic acid; cc-142; (1R,2R)-2-({4'-[(Phenylcarbamoyl)amino]biphenyl-4-yl}carbonyl)cyclopentanecarboxylic acid; A 922500 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.48 |
| Purity | >95 (HPLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 576.1±50.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | Desiccate at +4°C |
| Application | A 922500 is a potent, selective and orally available DGAT-1 inhibitor with IC50s of 9 and 22 nM for mouse and human DGAT-1, respectively. |
| MDL Number | MFCD12828780 |
| SMILES | N(c2ccc(cc2)c3ccc(cc3)C(=O)[C@H]4[C@@H](CCC4)C(=O)O)C(=O)Nc1ccccc1 |
| InChI | 1S/C26H24N2O4/c29-24(22-7-4-8-23(22)25(30)31)19-11-9-17(10-12-19)18-13-15-21(16-14-18)28-26(32)27-20-5-2-1-3-6-20/h1-3,5-6,9-16,22-23H,4,7-8H2,(H,30,31)(H2,27,28,32)/t22-,23-/m1/s1 |
| InChI Key | BOZRFEQDOFSZBV-DHIUTWEWSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352204 |
| MSDS | msds/59422_1_959122_11_3.pdf |
| Transport Info | Product name: A922500 |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 8-Bromo-6-chloroimidazo[1,2-a]pyridine | 957187-27-8 | 2A-9059409 |
| 8-Bromo-6-nitroimidazo[1,2-a]pyridine | 957187-28-9 | 2A-9059410 |
| 3-[[7-[3-[Ethyl[2-(phosphonooxy)ethyl]amino]propoxy]-4-quinazolinyl]amino]-N-(3-fluorophenyl)-1H-pyrazole-5-acetamide | 957881-03-7 | 2A-9059413 |
| 4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-carbaldehyde | 958230-19-8 | 2A-9059414 |
| 5-Isobutylthiophene-2-sulfonyl chloride | 958650-96-9 | 2A-9059419 |
| (3S,4S)-4-(Furan-2-yl)pyrrolidine-3-carboxylic acid | 959579-57-8 | 2A-9059426 |
| 3-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine | 1000340-39-5 | 2A-9059433 |
| 3-Bromo-5,6-dihydroimidazo[1,2-a]pyrazine-2,7(8H)-dicarboxylic acid 7-tert-butyl 2-ethyl ester | 1000576-75-9 | 2A-9059438 |
| 1H-Pyrrolo[2,3-b]pyridine-3-sulfonyl chloride | 1001412-59-4 | 2A-9059443 |
| 3-[(1S,2S)-2-Amino-1-[(4-chlorophenyl)methyl]propyl]benzonitrile 2,2,2-trifluoroacetate (1:1) | 1002752-56-8 | 2A-9059446 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA