
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 923564-51-6 |
| Catalog No. | 2A-9059165 |
| Chinese Name | 生根粉263 |
| Synonyms | Navitoclax; ABT263; ABT-263 |
| Molecular Formula | C47H55O6N5Cl1S3F3 |
| Molecular Weight | 974.63 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Melting Point | 114-116ºC |
| Appearance | Light yellow solid |
| Storage Condition | -20°C Freezer, Under Inert Atmosphere |
| Application | Navitoclax (ABT-263) is a potent, orally available Bcl-2 inhibitor that can bind to a variety of Bcl-2 family proteins such as Bcl-xL, Bcl-2, Bcl-w, etc., with a Ki value less than 1 nM. |
| HTC | 29339900 |
| MDL Number | MFCD12756219 |
| SMILES | CC1(C)CCC(c2ccc(Cl)cc2)=C(CN2CCN(c3ccc(C(=O)NS(=O)(=O)c4ccc(NC(CCN5CCOCC5)CSc5ccccc5)c(S(=O)(=O)C(F)(F)F)c4)cc3)CC2)C1 |
| InChI Key | JLYAXFNOILIKPP-KXQOOQHDSA-N |
| MSDS | msds/59165_1_923564_51_6.pdf |
| Transport Info | Product name: ABT-263 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2-Difluorocyclohexanamine | 921753-37-9 | 2A-9059157 |
| 4-Ethyl-2,5-dimethoxybenzeneethanamine hydrochloride | 923013-67-6 | 2A-9059159 |
| 2-(4-Isopropylthiazol-2-yl)-7-methoxy-8-methylquinolin-4-ol | 923289-21-8 | 2A-9059161 |
| 1-(2-Amino-3-bromo-4-methoxyphenyl)ethanone | 923289-30-9 | 2A-9059162 |
| 1-(2-Amino-3-chloro-4-methoxyphenyl)ethanone | 923289-36-5 | 2A-9059163 |
| Rebeprazole sulfone N-oxide | 924663-37-6 | 2A-9059169 |
| 2-Methoxy-4-(piperazin-1-yl)phenol | 925889-93-6 | 2A-9059174 |
| 1,2,3-Trifluoro-5-methoxy-4-nitrobenzene | 925890-13-7 | 2A-9059175 |
| 1,2,3,4-Tetrahydro-1-(2-methylpropyl)-7-quinolinamine | 927684-32-0 | 2A-9059182 |
| BIBF-1120 | 928326-83-4 | 2A-9059189 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA