
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 886499-94-1 |
| Catalog No. | 2A-9058883 |
| Chinese Name | 3-甲氧基-2,4,6-三氟苯甲酸 |
| Synonyms | JRD-1796; 3-Methoxy-2,4,6-trifluorobenzoic acid |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.11900 |
| Purity | 98.00 |
| Density | 1.487g/cm3 |
| Boiling Point | 291ºC at 760 mmHg |
| Melting Point | 129.8ºC |
| HTC | 2918990090 |
| SMILES | COc1c(F)cc(F)c(C(=O)O)c1F |
| InChI Key | HBJGDRQQDGUBGN-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Difluoro-3-methoxybenzylamine | 886498-50-6 | 2A-9058877 |
| 2,6-Difluoro-3-methoxyphenol | 886498-60-8 | 2A-9058878 |
| 3,5-Difluoro-4-methoxyphenylacetic acid | 886498-74-4 | 2A-9058879 |
| 2',6'-Difluoro-4'-methoxyacetophenone | 886498-84-6 | 2A-9058881 |
| 2,6-Difluoro-4-methoxyphenylacetic acid | 886498-98-2 | 2A-9058882 |
| 2,3-Difluoro-4-methoxybenzylamine | 886500-75-0 | 2A-9058884 |
| 5-Bromo-2-(trifluoromethoxy)aniline | 886762-08-9 | 2A-9058889 |
| 6-Chloro-2(3H)-pyridinone | 887570-97-0 | 2A-9058898 |
| 3-Pyridin-2-ylpropionamidine | 887578-66-7 | 2A-9058899 |
| 3-Pyridin-4-ylpropionamidine | 887578-79-2 | 2A-9058900 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA