
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 885267-15-2 |
| Catalog No. | 2A-9058815 |
| Chinese Name | 3-(3-溴苯)-1-环丁烷酮 |
| Synonyms | MFCD08706340 |
| Molecular Formula | C10H9O1Br1 |
| Molecular Weight | 225.08 |
| Purity | 98.00 |
| Density | 1.522g/cm3 |
| Boiling Point | 307.4ºC at 760 mmHg |
| Storage Condition | 2-8°C, dry, sealed |
| HTC | 2914700090 |
| MDL Number | MFCD04038979 |
| SMILES | O=C1CC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C10H9BrO/c11-9-3-1-2-7(4-9)8-5-10(12)6-8/h1-4,8H,5-6H2 |
| InChI Key | RLKCJCIUTBLVRJ-UHFFFAOYSA-N |
| MSDS | msds/58815_1_885267_15_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Choro-6-methoxynicotinic acid | 884494-85-3 | 2A-9058795 |
| 3-Bromo-5-fluoro-2-hydroxypyrdine | 884494-94-4 | 2A-9058797 |
| 5-Bromo-2-methoxy-3-nitro-4-picoline | 884495-14-1 | 2A-9058800 |
| 1,2,3-Trimethyl-3-benzyl-3H-benz[e]indolium bromide | 884863-08-5 | 2A-9058808 |
| N-Methyl-2-[[3-[(1E)-2-(2-pyridinyl)ethenyl]-1-(tetrahydro-2H-pyran-2-yl)-1H-indazol-6-yl]thio]benzamide | 885126-35-2 | 2A-9058811 |
| 1-(5-Methylpyridin-2-yl)ethylamine | 885277-04-3 | 2A-9058827 |
| (3-Amino-1-methylpropyl)carbamic acid benzyl ester | 885277-95-2 | 2A-9058832 |
| 4-Bromo-2,5-dichlorobenzoic acid | 885532-41-2 | 2A-9058845 |
| 3-Butyl-2-(2-[3-[2-(3-butyl-1,1-dimethyl-1,3-dihydrobenzo[e]indol-2-ylidene)ethylidene]-2-chloro-cyclohex-1-enyl]vinyl)-1,1-dimethyl-1H-benzo[e]indolium hexafluorophosphate | 885691-99-6 | 2A-9058847 |
| DL-Lysine monohydrate | 885701-25-7 | 2A-9058850 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA