
CAS Number872728-81-9
SynonymsN-[[2-[[[4-[[[(HEXYLOXY)CARBONYL]AMINO]IMINOMETHYL]PHENYL]AMINO]METHYL]-1-METHYL-1H-BENZIMIDAZOL-5-Y; Pradaxa; BIBR-1048 (DABIGATRAN)METHANESULFONATE; Dabigatran etexilate (mesylate); Dabigatran etexilate; PRODUCTS Dabigatran etexilate mesylate; Dabigatran Etexilate Mesylate; dabigatran etexilate methanesulfonate; Pradaxa mesylate
Molecular FormulaC35H45N7O8S
Molecular Weight723.84
Purity98.00%
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 872728-81-9 |
| Catalog No. | 2A-9058657 |
| Chinese Name | 甲磺酸达比加群酯 |
| Synonyms | N-[[2-[[[4-[[[(HEXYLOXY)CARBONYL]AMINO]IMINOMETHYL]PHENYL]AMINO]METHYL]-1-METHYL-1H-BENZIMIDAZOL-5-Y; Pradaxa; BIBR-1048 (DABIGATRAN)METHANESULFONATE; Dabigatran etexilate (mesylate); Dabigatran etexilate; PRODUCTS Dabigatran etexilate mesylate; Dabigatran Etexilate Mesylate; dabigatran etexilate methanesulfonate; Pradaxa mesylate |
| Molecular Formula | C35H45N7O8S |
| Molecular Weight | 723.84 |
| Purity | 98.00 |
| Storage Condition | 2-8°C |
| Application | Dabigatran etexilate mesylate (BIBR 1048MS) is an orally active dabigatran prodrug. Dabigatran is a reversible direct thrombin inhibitor (DTI) with a Ki of 4.5 nM. |
| SMILES | [S](=O)(=O)(O)C.[n]1(c2c(nc1CNc4ccc(cc4)\C(=N\C(=O)OCCCCCC)\N)cc(cc2)C(=O)N(CCC(=O)OCC)c3ncccc3)C |
| InChI Key | XETBXHPXHHOLOE-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/58657_1_872728_81_9.pdf |
| Transport Info | Product name: Dabigatran etexilate mesylate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Methyl-2-aminonicotinamide | 870997-87-8 | 2A-9058633 |
| Almorexant | 871224-64-5 | 2A-9058639 |
| (Z,E)-N'-Hydroxy-2-(2-oxopyridin-1(2H)-yl)ethanimidamide | 871544-57-9 | 2A-9058646 |
| 2,3-Dihydro-6,8-dimethyl-4H-1-benzothiopyran-4-one | 872283-26-6 | 2A-9058653 |
| 3-(5-Amino-3-methyl-1H-pyrazol-1-yl)benzoic acid | 872407-85-7 | 2A-9058654 |
| 3,29-Dibenzoyl rarounitriol | 873001-54-8 | 2A-9058658 |
| 4-Amino-3-chloro-5-methylphenol | 873417-25-5 | 2A-9058659 |
| (3R)-1-(3-Fluorophenyl)-3-pyrrolidinol 4-methylbenzenesulfonate | 873945-29-0 | 2A-9058663 |
| 2-Chloro-3-fluorobenzyl bromide | 874285-19-5 | 2A-9058669 |
| 3-[(6-Amino-3-pyridazinyl)methyl]benzoic acid methyl ester | 874338-90-6 | 2A-9058678 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA