
CAS Number868071-17-4
Synonyms(S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid; (S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butyric acid; 4-(2,4,5-trifluorophenyl)-3(S)-hydroxybutanoic acid; (3S)-2',4',5'-Trifluoro-3-hydroxybenzenebutanoic acid; 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybutanoic acid; (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)-butyric acid; 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybenzenebutanoic acid
Molecular FormulaC10H9O3F3
Molecular Weight234.17
Purity98.00%
Density1.459 g/cm3
Melting Point87ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 868071-17-4 |
| Catalog No. | 2A-9058573 |
| Chinese Name | (3S)-2',4',5'-三氟-3-羟基苯丁酸 |
| Synonyms | (S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid; (S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butyric acid; 4-(2,4,5-trifluorophenyl)-3(S)-hydroxybutanoic acid; (3S)-2',4',5'-Trifluoro-3-hydroxybenzenebutanoic acid; 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybutanoic acid; (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)-butyric acid; 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybenzenebutanoic acid |
| Molecular Formula | C10H9O3F3 |
| Molecular Weight | 234.17 |
| Purity | 98.00 |
| Density | 1.459 g/cm3 |
| Melting Point | 87ºC |
| HTC | 2918199090 |
| MDL Number | MFCD09833198 |
| SMILES | O=C(O)CC(O)Cc1cc(F)c(F)cc1F |
| InChI Key | WHFKHBXZZAXQOD-LURJTMIESA-N |
| MSDS | msds/58573_1_868071_17_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Dulanermin | 867153-61-5 | 2A-9058564 |
| 3-Chloropyrazin-2-methanamine dihydrochloride | 867165-53-5 | 2A-9058566 |
| 1,1,1,3,3,3-Hexafluoro-2-methylpropan-2-yl 4-[(4-hydroxy-2-oxo-2H-chromen-3-yl)methyl]benzoate | 867257-26-9 | 2A-9058569 |
| 7-Bromo-5-methylbenzo[e][1,2,4]triazin-3-amine | 867330-26-5 | 2A-9058570 |
| 6-Hydroxy-8-[(1R)-1-hydroxy-2-[[2-(4-methoxyphenyl)-1,1-dimethylethyl]amino]ethyl]-2H-1,4-benzoxazin-3(4H)-one | 868049-49-4 | 2A-9058572 |
| 2-Morpholin-4-ylmethylbenzoic acid | 868543-19-5 | 2A-9058577 |
| Bis[N-[1-ethyl-1,2,3,4-tetrahydro-6-[(1,3,4-thiadiazol-2-yl-N3)azo-N1]-7-quinolinyl]-1,1,1-trifluoromethanesulfonamidato-N]nickel | 868747-30-2 | 2A-9058581 |
| Melogliptin | 868771-57-7 | 2A-9058582 |
| N-Acetyl-L-alpha-glutamyl-L-alpha-glutamyl-L-methionyl-L-glutaminyl-L-arginyl-L-arginyl-L-alanyl-L-alpha-asparagine | 868844-74-0 | 2A-9058583 |
| N-(6-Chloro-3-pyridazinyl)propanamide | 868948-11-2 | 2A-9058584 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA