
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 845823-12-3 |
| Catalog No. | 2A-9058305 |
| Chinese Name | 1-(3,5-二氟苯基)-2,2,2-三氟乙酮 |
| Synonyms | 1-(3,5-Difluorophenyl)-2,2,2-trifluoroethanone; FXFFVR CF EF |
| Molecular Formula | C8H3O1F5 |
| Molecular Weight | 210.1 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 173.4±35.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2914700090 |
| MDL Number | MFCD01319993 |
| SMILES | O=C(c1cc(F)cc(F)c1)C(F)(F)F |
| InChI Key | VPJBBHOADBTNFQ-UHFFFAOYSA-N |
| MSDS | msds/58305_1_845823_12_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Atacicept | 845264-92-8 | 2A-9058298 |
| Sevelamer carbonate | 845273-93-0 | 2A-9058299 |
| Aflibercept | 845771-78-0 | 2A-9058302 |
| Lexatumumab | 845816-02-6 | 2A-9058303 |
| 4-Fluoro-2-methylthiophenol | 845823-04-3 | 2A-9058304 |
| 4-(5-Methyl-2-pyridinyl)benzoic acid | 845826-92-8 | 2A-9058306 |
| 4-Fluoro-3-formylbenzoic acid | 845885-90-7 | 2A-9058312 |
| Lorcaserin hydrochloride | 846589-98-8 | 2A-9058317 |
| 1-[[2-(4-Chlorophenyl)ethyl]amino]-2-hydroxypropane | 847063-13-2 | 2A-9058318 |
| Oxazol-5-yl-methylamine hydrochloride | 847491-00-3 | 2A-9058323 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA