
CAS Number844891-04-9
Synonyms1,3,5-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole; 1,3,5-TRIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE
Molecular FormulaC12H21BN2O2
Molecular Weight236.118
Purity98.00%
Density1.0±0.1 g/cm3
Boiling Point335.7±42.0 °C at 760 mmHg
Melting Point91-93ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 844891-04-9 |
| Catalog No. | 2A-9058297 |
| Chinese Name | 1,3,5-三甲基-1H-吡唑-4-硼酸频哪醇酯 |
| Synonyms | 1,3,5-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole; 1,3,5-TRIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE |
| Molecular Formula | C12H21BN2O2 |
| Molecular Weight | 236.118 |
| Purity | 98.00 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 335.7±42.0 °C at 760 mmHg |
| Melting Point | 91-93ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | 2-8°C |
| HTC | 2934999090 |
| SMILES | Cc1nn(C)c(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H21BN2O2/c1-8-10(9(2)15(7)14-8)13-16-11(3,4)12(5,6)17-13/h1-7H3 |
| InChI Key | IZNGYNMIIVJWSO-UHFFFAOYSA-N |
| MSDS | msds/58297_1_844891_04_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1-Propyl-1H-pyrazole-4-boronic acid pinacol ester | 827614-69-7 | 2A-9058265 |
| 3,5-Dimethylisoxazole-4-boronic acid pinacol ester | 832114-00-8 | 2A-9058272 |
| 1-Methylindole-5-boronic acid pinacol ester | 837392-62-8 | 2A-9058283 |
| 5-Methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid | 839720-60-4 | 2A-9058286 |
| 4-Cyano-3-fluorophenylboronic acid | 843663-18-3 | 2A-9058291 |
| 4-Benzyloxy-3-chlorophenylboronic acid | 845551-44-2 | 2A-9058301 |
| 3-Ethylsulfonylphenylboronic acid | 845870-47-5 | 2A-9058310 |
| 4-Benzyloxy-2-methylphenylboronic acid | 847560-49-0 | 2A-9058325 |
| 1-Methyl-1H-pyrazole-4-boronic acid | 847818-55-7 | 2A-9058326 |
| 1-Methyl-1H-pyrazole-5-boronic acid pinacol ester | 847818-74-0 | 2A-9058327 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA