
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 827318-97-8 |
| Catalog No. | 2A-9058260 |
| Chinese Name | 达鲁舍替 |
| Synonyms | 5-Amido-pyrrolopyrazole 9d; UNII-M3X659D0FY; danusertib; S1107_Selleck; PHA-739358 |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.55 |
| Purity | ≥98 (HPLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 664.1±55.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | -20℃ |
| Application | Danusertib is an aurora kinase inhibitor that inhibits the activities of Aurora A, Aurora B and Aurora C with IC50 values of 13, 79 and 61 nM respectively. |
| MDL Number | MFCD35089549 |
| SMILES | O=C(C1=CC=C(N2CCN(CC2)C)C=C1)NC3=NNC4=C3CN(C([C@@H](C5=CC=CC=C5)OC)=O)C4 |
| InChI | 1S/C26H30N6O3/c1-30-12-14-31(15-13-30)20-10-8-19(9-11-20)25(33)27-24-21-16-32(17-22(21)28-29-24)26(34)23(35-2)18-6-4-3-5-7-18/h3-11,23H,12-17H2,1-2H3,(H2,27,28,29,33)/t23-/m1/s1 |
| InChI Key | XKFTZKGMDDZMJI-HSZRJFAPSA-N |
| NACRES Code | NA.21 |
| MSDS | msds/58260_1_827318_97_8.pdf |
| Transport Info | Product name: Daruseti |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 16-Amino-5,8,11,14-tetraoxa-2-azahexadecanoic acid 1,1-dimethylethyl ester | 811442-84-9 | 2A-0201879 |
| 4-Amino-4-naphthalen-1-ylbutyric acid methyl ester hydrochloride | 811842-01-0 | 2A-9058240 |
| Polybutyleneglycol bis(9-oxo-9H-thioxanthenyloxy)acetate | 813452-37-8 | 2A-9058244 |
| Ustekinumab | 815610-63-0 | 2A-0202039 |
| N-Acetyl-beta-alanyl-L-histidyl-L-seryl-L-histidine | 820959-17-9 | 2A-9058251 |
| tert-Butyl piperazin-1-ylacetate dihydrochloride | 827614-56-2 | 2A-9058263 |
| Acetildenafil | 831217-01-7 | 2A-9058271 |
| 2-Fluoro-4-(methylsulfonyl)aniline | 832755-13-2 | 2A-9058274 |
| Elagolix | 834153-87-6 | 2A-9058276 |
| [(2R)-2-[[(tert-Butoxy)carbonyl]amino]-3-phenylpropyl]carbamic acid benzyl ester | 835916-04-6 | 2A-9058278 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA