
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 796967-16-3 |
| Catalog No. | 2A-9058213 |
| Chinese Name | 利尼伐尼 |
| Synonyms | Linifanib; S1003_Selleck; Kinome_532; ABT 869; ABT-869 |
| Molecular Formula | C21H18O1N5F1 |
| Molecular Weight | 375.41 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 542.2±50.0 °C at 760 mmHg |
| Melting Point | 180-183ºC (dec.) |
| Storage Condition | -20?C Freezer |
| Application | Linifanib (ABT-869) is a multi-target inhibitor of the VEGF and PDGFR receptor families. The IC50 values for inhibiting KDR, Flt-1, PDGFRβ and FLT3 are 3, 4, 66 and 4 nM respectively. |
| MDL Number | MFCD11840918 |
| SMILES | Cc1ccc(F)c(NC(=O)Nc2ccc(-c3cccc4[nH]nc(N)c34)cc2)c1 |
| InChI Key | MPVGZUGXCQEXTM-UHFFFAOYSA-N |
| MSDS | msds/58213_1_796967_16_3.pdf |
| Transport Info | Product name: Linifanib (ABT-869) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2'-Diiodo-9,9'-spirobifluorene | 790674-48-5 | 2A-9058198 |
| Simotaxel | 791635-59-1 | 2A-9058202 |
| Aderbasib | 791828-58-5 | 2A-9058204 |
| (5-Methyl-pyridin-2-yl)-piperidin-4-yl-amine dihydrochloride | 793675-05-5 | 2A-9058208 |
| 4-(tert-Butyl)-2-ethoxybenzoic acid | 796875-53-1 | 2A-9058212 |
| Ethyl 3-nitropyridin-4-yl(cyclopropyl)carbamate | 797032-05-4 | 2A-9058215 |
| 4,5-Bis(4-methoxyphenyl)-1H-pyrazol-3-amine | 802919-05-7 | 2A-9058232 |
| 6,7,8-Trifluoro-2-tetralone | 808144-34-5 | 2A-9058235 |
| 16-Amino-5,8,11,14-tetraoxa-2-azahexadecanoic acid 1,1-dimethylethyl ester | 811442-84-9 | 2A-0201879 |
| 4-Amino-4-naphthalen-1-ylbutyric acid methyl ester hydrochloride | 811842-01-0 | 2A-9058240 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA