
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 773873-26-0 |
| Catalog No. | 2A-9058154 |
| Chinese Name | 2,3-二氟-6-甲氧苯甲酸 |
| Synonyms | 5,6-Difluoro-o-anisic acid; 2,3-Difluoro-6-methoxybenzoic acid; QVR BF CF FO1; MFCD04116018 |
| Molecular Formula | C8H6O3F2 |
| Molecular Weight | 188.13 |
| Purity | 98.00 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 275.0±35.0 °C at 760 mmHg |
| Melting Point | 126-129ºC |
| Storage Condition | Sealed, cool, dry place |
| HTC | 2918990090 |
| MDL Number | MFCD04116018 |
| SMILES | COc1ccc(F)c(F)c1C(=O)O |
| InChI | InChI=1S/C8H6F2O3/c1-13-5-3-2-4(9)7(10)6(5)8(11)12/h2-3H,1H3,(H,11,12) |
| InChI Key | MMTKYWQMCSZCGW-UHFFFAOYSA-N |
| MSDS | msds/58154_1_773873_26_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-[4-[(4-Amino-2-fluorophenyl)thio]phenyl]acetamide | 771477-12-4 | 2A-9058143 |
| 2,6-Difluoro-4-methoxybenzylamine | 771573-20-7 | 2A-9058144 |
| 2-(4-Methoxyphenethylamino)-1-(4-methoxyphenyl)propan-1-one | 773045-10-6 | 2A-9058146 |
| 3-(4-Amino-3-pyridinyl)-2-propenoic acid | 773132-83-5 | 2A-9058151 |
| Methyl 4-bromo-2,6-difluorobenzoate | 773134-11-5 | 2A-9058152 |
| 6-Bromotryptophan methyl ester | 774181-71-4 | 2A-9058156 |
| N-Dodecanoyl-L-alanine | 775242-37-0 | 2A-9058158 |
| 3-[5-(2-Fluorophenyl)-1,2,4-oxadiazol-3-yl]benzoic acid | 775304-57-9 | 2A-9058160 |
| L-Threonic acid magnesium salt | 778571-57-6 | 2A-0202206 |
| 2-(4-Hydroxyphenethylamino)-1-(4-hydroxyphenyl)propan-1-one | 779979-39-4 | 2A-9058168 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA