
CAS Number624729-66-4
Synonyms8-Amino-1,2,3,4-tetrahydronaphthalen-2-ol; 8-amino-1,2,3,4-tetrahydro-naphthalen-2-ol; 8-Amino-1,2,3,4-tetrahydro-2-naphthalenol; 8-Amino-1,2,3,4-tetrahydro-naphthal; 8-amino-1,2,3,4-tetrahydro-2-naphthol
Molecular FormulaC10H13NO
Molecular Weight221.25
Purity98.00%
Density1.2±0.1 g/cm3
Boiling Point347.1±42.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 624729-66-4 |
| Catalog No. | 2A-9057732 |
| Chinese Name | 8-氨基-1,2,3,4-四氢-2-萘酚 |
| Synonyms | 8-Amino-1,2,3,4-tetrahydronaphthalen-2-ol; 8-amino-1,2,3,4-tetrahydro-naphthalen-2-ol; 8-Amino-1,2,3,4-tetrahydro-2-naphthalenol; 8-Amino-1,2,3,4-tetrahydro-naphthal; 8-amino-1,2,3,4-tetrahydro-2-naphthol |
| Molecular Formula | C10H13NO |
| Molecular Weight | 221.25 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 347.1±42.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2922299090 |
| PubChem ID | 329785060 |
| MDL Number | MFCD07369844 |
| SMILES | COc1cccc2CCC(N)(Cc12)C(O)=O |
| InChI | 1S/C12H15NO3/c1-16-10-4-2-3-8-5-6-12(13,11(14)15)7-9(8)10/h2-4H,5-7,13H2,1H3,(H,14,15) |
| InChI Key | BGWOJKDTFULIKJ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/57732_1_624729_66_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Lorcaserin | 616202-92-7 | 2A-9057719 |
| Vabicaserin | 620948-93-8 | 2A-9057723 |
| Methyl (2R)-2-bromo-2-(2-chlorophenyl)acetate | 622835-93-2 | 2A-9057724 |
| N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-L-lysine 2,2,2-trifluoroacetate (1:2) | 623172-56-5 | 2A-9057726 |
| Tasidotin hydrochloride | 623174-20-9 | 2A-9057727 |
| Riociguat | 625115-55-1 | 2A-9057734 |
| 4'-Bromo-2'-fluoroacetophenone | 625446-22-2 | 2A-9057737 |
| 2,3,4,6-Tetra-O-benzoyl-D-mannopyranose | 627466-98-2 | 2A-9057741 |
| 5-[[4-[2-(5-Ethyl-2-pyridinyl)ethoxy]benzylidene]-2,4-thiazolidinedione | 627502-58-3 | 2A-9057742 |
| 4,5-Difluoroindan-1-one | 628732-11-6 | 2A-9057746 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA