
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 606493-11-2 |
| Catalog No. | 2A-9057686 |
| Chinese Name | 3-(4-氯苯基)-2-甲氧基丙酸 |
| Synonyms | 4-Chloro-α-methoxyphenylpropionic acid |
| Molecular Formula | (CH3)2CHCH(C6H5Cl)CO2H |
| Molecular Weight | 212.67 |
| Purity | 96 |
| Density | 1.273 |
| Boiling Point | 340.853ºC at 760 mmHg |
| Melting Point | 87-91 °C (lit.) |
| EINECS | 217-934-1 |
| HTC | 2918990090 |
| PubChem ID | 24878202 |
| MDL Number | MFCD00037763 |
| SMILES | CC(C)C(C(O)=O)c1ccc(Cl)cc1 |
| InChI | 1S/C11H13ClO2/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8/h3-7,10H,1-2H3,(H,13,14) |
| InChI Key | VTJMSIIXXKNIDJ-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/57686_1_606493_11_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-4-fluoro-5-[(1-methyl-1H-imidazol-2-yl)thio]-N-thiazol-2-ylbenzamide | 603107-76-2 | 2A-9057674 |
| Methyl 4-borono-3-chlorobenzoate | 603122-80-1 | 2A-9057676 |
| 5-(1-Methylethyl)-2-pyridinamine | 603310-75-4 | 2A-9057680 |
| 9,9-Dimethyl-2-nitro-9H-fluorene | 605644-46-0 | 2A-9057682 |
| Catridecacog | 606138-08-3 | 2A-9057683 |
| 2,6-Dichloroquinolin-5-amine | 607380-28-9 | 2A-9057690 |
| Lisdexamfetamine dimesylate | 608137-33-3 | 2A-9057692 |
| 3-Amino-N-(tert-butyl)benzenesulfonamide | 608523-94-0 | 2A-9057693 |
| [6,6]-Phenyl C71 butyric acid methyl ester | 609771-63-3 | 2A-9057696 |
| Tasimelteon | 609799-22-6 | 2A-9057700 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA