
CAS Number345-89-1
Synonyms(4-Fluorophenyl)(4-methoxyphenyl)methanone; 4-Fluor-4'-methoxy-benzophenon; EINECS 206-464-2; (4-Fluoro-phenyl)(4-methoxyphenyl)methanone; (4-fluorophenyl)(4-methoxyphenyl)ketone; (4-fluorophenyl)-(4-methoxyphenyl)-methanone; 4-fluoro-4'-methoxybenzophenone; MFCD00055469; (4-fluorphenyl)(4-methoxyphenyl)methanon
Molecular FormulaC14H11FO2
Molecular Weight230.23
Purity98%
Density1.2±0.1 g/cm3
Boiling Point351.4±27.0 °C at 760 mmHg
Melting Point90-92ºC
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 345-89-1 |
| Catalog No. | 2A-9005768 |
| Chinese Name | 4-氟-4'-甲氧基二苯甲酮 |
| Synonyms | (4-Fluorophenyl)(4-methoxyphenyl)methanone; 4-Fluor-4'-methoxy-benzophenon; EINECS 206-464-2; (4-Fluoro-phenyl)(4-methoxyphenyl)methanone; (4-fluorophenyl)(4-methoxyphenyl)ketone; (4-fluorophenyl)-(4-methoxyphenyl)-methanone; 4-fluoro-4'-methoxybenzophenone; MFCD00055469; (4-fluorphenyl)(4-methoxyphenyl)methanon |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.23 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 351.4±27.0 °C at 760 mmHg |
| Melting Point | 90-92ºC |
| Appearance | solid |
| Storage Condition | room temperature, sealed |
| HTC | 2914700090 |
| PubChem ID | 329780101 |
| MDL Number | MFCD00055469 |
| SMILES | COc1ccc(cc1)C(=O)c2ccc(F)cc2 |
| InChI | 1S/C14H11FO2/c1-17-13-8-4-11(5-9-13)14(16)10-2-6-12(15)7-3-10/h2-9H,1H3 |
| InChI Key | VWGWRNBIAWTWIB-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/5768_1_345_89_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Fluoro-3'-nitroacetophenone | 400-93-1 | 2A-9005760 |
| 4-Fluoro-3-nitroaniline | 364-76-1 | 2A-9005761 |
| 4-Fluoro-3-nitrobenzoic acid | 453-71-4 | 2A-9005762 |
| 4-Fluoro-3-nitrobenzyl bromide | 15017-52-4 | 2A-9005763 |
| 4-Fluoro-3-nitrophenol | 2105-96-6 | 2A-9005764 |
| 4-Fluoroanisole | 459-60-9 | 2A-9005770 |
| 4-Fluorobenzamide | 824-75-9 | 2A-9005771 |
| 4-Fluorobenzenesulfonamide | 402-46-0 | 2A-9005772 |
| 4-Fluorobenzenesulfonic acid | 368-88-7 | 2A-9005773 |
| 4-Fluorobenzenesulphonyl chloride | 349-88-2 | 2A-9005774 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA