
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 572924-54-0 |
| Catalog No. | 2A-9057620 |
| Chinese Name | 息斯敏 |
| Synonyms | Deforolimus; Ridaforolimus |
| Molecular Formula | C53H84NO14P |
| Molecular Weight | 990.21 |
| Purity | ≥95 (HPLC) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 996.2±75.0 °C at 760 mmHg |
| Melting Point | 95-98ºC |
| Appearance | powder |
| Storage Condition | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |
| Application | Deforolimus (AP23573; MK-8669) is a potent and selective mTOR inhibitor with an IC50 value of 0.2 nM for inhibiting S6 phosphorylation in HT-1080 cells. |
| MDL Number | MFCD13184816 |
| SMILES | O=C(N1CCCC[C@]12[H])C([C@@]3(O)[C@@H](CC[C@]([H])(O3)C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@H](C([C@@H]([C@H](O)/C(C)=C/[C@H](C(C[C@@]([H])([C@@H](C[C@H]4C[C@@H](OC)[C@@H](CC4)OP(C)(C)=O)C)OC2=O)=O)C)OC)=O)C)C)=O |
| InChI | 1S/C53H84NO14P/c1-32-18-14-13-15-19-33(2)44(63-8)30-40-23-21-38(7)53(61,67-40)50(58)51(59)54-25-17-16-20-41(54)52(60)66-45(35(4)28-39-22-24-43(46(29-39)64-9)68-69(11,12)62)31-42(55)34(3)27-37(6)48(57)49(65-10)47(56)36(5)26-32/h13-15,18-19,27,32,34-36,38-41,43-46,48-49,57,61H,16-17,20-26,28-31H2,1-12H3/b15-13+,18-14+,33-19+,37-27+/t32-,34-,35-,36-,38-,39+,40+,41+,43-,44+,45+,46-,48-,49+,53-/m1/s1 |
| InChI Key | BUROJSBIWGDYCN-GAUTUEMISA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/57620_1_572924_54_0.pdf |
| Transport Info | Product Name: Ridaforolimus (Deforolimus, MK-8669) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Methylthio)benzoic acid | 562836-64-0 | 2A-9057610 |
| 2-(Dicyclohexylphosphino)-2',4',6'-triisopropylbiphenyl | 564483-18-7 | 2A-9057612 |
| Raxibacumab | 565451-13-0 | 2A-9057613 |
| Methyl 2-(N-phthalimidomethyl)-3-oxobutyrate | 565471-90-1 | 2A-9057614 |
| 1-((Quinolin-2-yl)methyl)piperidin-4-one | 571147-27-8 | 2A-9057618 |
| 4-(4-Fluoro-2-methyl-1H-indol-5-yloxy)-6-methoxyquinazolin-7-ol | 574745-76-9 | 2A-9057623 |
| tert-Butyl [(1R)-1-(4-bromophenyl)ethyl]carbamate | 578729-21-2 | 2A-9057630 |
| N,N'-Bis(4-ethoxycarbonylphenyl)-N-benzylformamidine | 586400-06-8 | 2A-9057634 |
| 2-Morpholin-4-yl-6-thianthren-1-ylpyran-4-one | 587871-26-9 | 2A-9057636 |
| 3-Cyclopentylacrylonitrile | 591769-05-0 | 2A-9057653 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA