
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 486449-90-5 |
| Catalog No. | 2A-9057427 |
| Chinese Name | 4-(3,4-二氟苯氧基)苯甲醛 |
| Synonyms | 4-(3,4-Difluorphenoxy)benzolcarbaldehyd; 4-(3,4-Difluorophenoxy)benzaldehyde; VHR DOR CF DF |
| Molecular Formula | C13H8O2F2 |
| Molecular Weight | 234.2 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 316.6±42.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, inert gas |
| HTC | 2913000090 |
| MDL Number | MFCD09038283 |
| SMILES | O=Cc1ccc(Oc2ccc(F)c(F)c2)cc1 |
| InChI Key | XVYWAQAFWQZGBI-UHFFFAOYSA-N |
| MSDS | msds/57427_1_486449_90_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Ethoxy-4-fluorophenylboronic acid | 480438-58-2 | 2A-9057412 |
| 3-Methoxycyclobutanecarboxylic acid | 480450-03-1 | 2A-9057414 |
| 4-Acetyl-3-fluorophenylboronic acid | 481725-35-3 | 2A-9057416 |
| 6-(Morpholin-4-yl)pyridine-3-boronic acid pinacol ester | 485799-04-0 | 2A-9057421 |
| 4-(Morpholinosulfonyl)phenylboronic acid | 486422-68-8 | 2A-9057424 |
| (4-Hydroxy-2-methyl)phenylboronic acid | 493035-82-8 | 2A-9057438 |
| 3-Fluoro-4-morpholin-4-ylbenzaldehyde | 495404-90-5 | 2A-9057445 |
| 1,3-Benzothiazol-2-ylboronic acid | 499769-96-9 | 2A-9057455 |
| 5-Bromo-2-fluoro-3-pyridylboronic acid | 501435-91-2 | 2A-9057477 |
| 5-Fluorobenzothiophene-2-boronic acid | 501944-42-9 | 2A-9057481 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA