
CAS Number80517-21-1
SynonymsWNR CF DCN; 4-Fluoro-2-nitrobenzonitrile; 2-Fluoro-4-nitrobenzonitrile; MFCD00277447
Molecular FormulaC7H3FN2O2
Molecular Weight166.109
Purity97%
Density1.4±0.1 g/cm3
Boiling Point311.6±27.0 °C at 760 mmHg
Melting Point71ºC
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 80517-21-1 |
| Catalog No. | 2A-9005740 |
| Chinese Name | 4-氟-2-硝基苯甲腈 |
| Synonyms | WNR CF DCN; 4-Fluoro-2-nitrobenzonitrile; 2-Fluoro-4-nitrobenzonitrile; MFCD00277447 |
| Molecular Formula | C7H3FN2O2 |
| Molecular Weight | 166.109 |
| Purity | 97 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 311.6±27.0 °C at 760 mmHg |
| Melting Point | 71ºC |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Room Temperature |
| HTC | 2926909090 |
| SMILES | N#Cc1ccc(F)cc1[N+](=O)[O-] |
| InChI Key | MNEAKKQYFSYZEU-UHFFFAOYSA-N |
| MSDS | msds/5740_1_80517_21_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluoro-2-methylbenzoic acid | 321-21-1 | 2A-9005735 |
| 4-Fluoro-2-methylbenzonitrile | 147754-12-9 | 2A-9005736 |
| 4-Fluoro-2-methylphenol | 452-72-2 | 2A-9005737 |
| 4-Fluoro-2-nitroaniline | 364-78-3 | 2A-9005738 |
| 4-Fluoro-2-nitrobenzoic acid | 394-01-4 | 2A-9005739 |
| 4-Fluoro-2-nitrobenzotrifluoride | 2A-105741 | 2A-9005741 |
| 4-Fluoro-2-nitrophenol | 394-33-2 | 2A-9005742 |
| 4-Fluoro-3-methoxyaniline | 64465-53-8 | 2A-9005750 |
| 4-Fluoro-3-methoxybenzonitrile | 243128-37-2 | 2A-9005752 |
| 4-Fluoro-3-methoxynitrobenzene | 445-93-6 | 2A-9005753 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA