
CAS Number6269-89-2
Synonyms1-Nitro-4-piperazinobenzene; N-(P-NITROPHENYL) PIPERAZINE; Piperazine,1-(4-nitrophenyl); 1-(4-NO2Ph)Pip; 1-(4-nitro-phenyl)-piperazine; RARECHEM AH CK 0146; 4-nitro-1-(1-piperazinyl)benzene; 1-(4-Nitrophenyl)piperazine; 4-(4-nitrophenyl)piperazine; 1-(P-NITROPHENYL)PIPERAZINE; N-(4-nitrophenyl)-piperazine; EINECS 228-443-7; MFCD00005961
Molecular FormulaC10H13N3O2
Molecular Weight207.23
Purity97%
Density1.2±0.1 g/cm3
Boiling Point391.9±27.0 °C at 760 mmHg
Melting Point131-133 °C (lit.)
AppearanceYellow to ocher powder
EINECS228-443-7
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6269-89-2 |
| Catalog No. | 2A-9000574 |
| Chinese Name | 1-(4-硝基苯基)哌嗪 |
| Synonyms | 1-Nitro-4-piperazinobenzene; N-(P-NITROPHENYL) PIPERAZINE; Piperazine,1-(4-nitrophenyl); 1-(4-NO2Ph)Pip; 1-(4-nitro-phenyl)-piperazine; RARECHEM AH CK 0146; 4-nitro-1-(1-piperazinyl)benzene; 1-(4-Nitrophenyl)piperazine; 4-(4-nitrophenyl)piperazine; 1-(P-NITROPHENYL)PIPERAZINE; N-(4-nitrophenyl)-piperazine; EINECS 228-443-7; MFCD00005961 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 391.9±27.0 °C at 760 mmHg |
| Melting Point | 131-133 °C (lit.) |
| Appearance | Yellow to ocher powder |
| Storage Condition | Store at room temperature, away from light, in a c |
| Packaging | III |
| EINECS | 228-443-7 |
| HTC | 2933599090 |
| PubChem ID | 24856908 |
| MDL Number | MFCD00005961 |
| SMILES | [O-][N+](=O)c1ccc(cc1)N2CCNCC2 |
| InChI | 1S/C10H13N3O2/c14-13(15)10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11H,5-8H2 |
| InChI Key | VWOJSRICSKDKAW-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 6.1 |
| Risk Codes | R36/37/38 |
| Safety Description | S24/25 |
| MSDS | msds/574_1_6269_89_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(4-Methoxyphenyl)piperazine dihydrochloride | 38869-47-5 | 2A-9000565 |
| 1-(4-Nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl chloride | 175137-36-7 | 2A-9000569 |
| 1-(4-Nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid | 142818-03-9 | 2A-9000570 |
| 1-(4-Nitrophenyl)-5-phenyl-[1,2,3]triazole-4-carboxylic acid | 2A-100571 | 2A-9000571 |
| 1-(4-Nitrophenyl)imidazole | 2301-25-9 | 2A-9000572 |
| 1-(4-Nitrophenyl)-pyrrole-2,5-dione | 4338-06-1 | 2A-9000576 |
| 1-(4-Propoxybenzoyl)pyrrolidine-2-carboxylic acid | 2A-100578 | 2A-9000578 |
| 1-(4-tert-Butylbenzyl)piperazine | 956-61-6 | 2A-9000580 |
| 1-(5-Chloro-2-methoxyphenyl)piperazine hydrochloride | 99857-72-4 | 2A-9000581 |
| 1-(5-Chloro-2-nitrophenyl)-3,4-dihydro-6,7-dimethoxyisoquinoline | 62206-13-7 | 2A-9000582 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA